The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Isopropyl ((R)-(((2R,3R,4R,5R)-5-(3-amino-2-oxopyrazin-1(2H)-yl)-3,4-dihydroxy-4-methyltetrahydrofuran-2-yl)methoxy)(phenoxy)phosphoryl)-D-alaninate ID: ALA4533213
PubChem CID: 155547082
Max Phase: Preclinical
Molecular Formula: C22H31N4O9P
Molecular Weight: 526.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1O[C@@H](n2ccnc(N)c2=O)[C@](C)(O)[C@@H]1O)Oc1ccccc1
Standard InChI: InChI=1S/C22H31N4O9P/c1-13(2)33-20(29)14(3)25-36(31,35-15-8-6-5-7-9-15)32-12-16-17(27)22(4,30)21(34-16)26-11-10-24-18(23)19(26)28/h5-11,13-14,16-17,21,27,30H,12H2,1-4H3,(H2,23,24)(H,25,31)/t14-,16-,17-,21-,22-,36-/m1/s1
Standard InChI Key: UEEKKYBKWBCXFY-BKNXKGLUSA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
27.6937 -25.6631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.6928 -26.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9848 -26.8839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9835 -27.7003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6913 -28.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4018 -27.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3996 -26.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6937 -24.2475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1064 -24.9574 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
28.5148 -24.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2335 -25.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0025 -26.5546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2968 -26.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2958 -26.9615 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5552 -25.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4837 -26.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8923 -24.8872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2624 -24.9597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2624 -24.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9676 -25.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6729 -24.9597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6729 -24.1425 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9676 -23.7298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9676 -26.1814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0025 -26.8065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.8181 -25.3693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5258 -24.9607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8765 -24.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4701 -24.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6529 -24.9614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8808 -25.6654 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4658 -23.5435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2464 -25.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4292 -25.6728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6572 -26.3768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3800 -25.3693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
9 8 1 0
10 9 2 0
16 13 1 0
13 15 1 0
15 17 1 0
17 11 1 0
11 16 1 0
15 18 1 1
19 18 1 0
19 23 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
20 24 2 0
13 12 1 1
13 14 1 0
16 25 1 6
26 27 1 0
11 27 1 1
26 9 1 0
8 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
9 1 1 6
28 32 1 1
30 33 1 0
33 34 1 0
33 35 1 0
21 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.48Molecular Weight (Monoisotopic): 526.1829AlogP: 0.97#Rotatable Bonds: 10Polar Surface Area: 184.46Molecular Species: NEUTRALHBA: 12HBD: 4#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.24CX Basic pKa: 5.10CX LogP: 0.07CX LogD: 0.07Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: 0.39
References 1. Guo S, Xu M, Guo Q, Zhu F, Jiang X, Xie Y, Shen J.. (2019) Discovery of pyrimidine nucleoside dual prodrugs and pyrazine nucleosides as novel anti-HCV agents., 27 (5): [PMID:30683552 ] [10.1016/j.bmc.2019.01.007 ]