The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(1,4-Diazepan-1-yl)-1-isopropyl-N-((6-methyl-2-oxo-4-propyl-1,2-dihydropyridin-3-yl)methyl)-1H-indazole-4-carboxamide ID: ALA4533229
PubChem CID: 155547180
Max Phase: Preclinical
Molecular Formula: C26H36N6O2
Molecular Weight: 464.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1cc(C)[nH]c(=O)c1CNC(=O)c1cc(N2CCCNCC2)cc2c1cnn2C(C)C
Standard InChI: InChI=1S/C26H36N6O2/c1-5-7-19-12-18(4)30-26(34)22(19)15-28-25(33)21-13-20(31-10-6-8-27-9-11-31)14-24-23(21)16-29-32(24)17(2)3/h12-14,16-17,27H,5-11,15H2,1-4H3,(H,28,33)(H,30,34)
Standard InChI Key: ZBMXBJZKOIFKKZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
11.3053 -8.5251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7875 -7.8664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3135 -7.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5339 -7.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8287 -7.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1199 -7.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1164 -8.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8217 -8.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5304 -8.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8363 -6.2178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1311 -5.8068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5451 -5.8158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5486 -4.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2650 -3.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2615 -4.5926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9667 -5.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6755 -4.6017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6790 -3.7845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9737 -3.3693 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9591 -5.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6643 -6.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3772 -5.8299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5597 -3.3643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3919 -3.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5150 -9.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3041 -9.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9365 -9.8883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4096 -8.6673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7098 -8.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9509 -8.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4598 -9.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8469 -10.0273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0094 -9.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6387 -9.1869 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
1 9 1 0
4 9 2 0
10 11 2 0
10 12 1 0
5 10 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 1 0
20 21 1 0
21 22 1 0
16 20 1 0
14 23 2 0
18 24 1 0
13 15 1 0
12 13 1 0
1 25 1 0
25 26 1 0
25 27 1 0
28 29 1 0
29 30 1 0
28 31 1 0
32 33 1 0
33 34 1 0
34 30 1 0
31 32 1 0
7 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.61Molecular Weight (Monoisotopic): 464.2900AlogP: 3.30#Rotatable Bonds: 7Polar Surface Area: 95.05Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.64CX Basic pKa: 9.64CX LogP: 1.79CX LogD: -0.32Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -1.32
References 1. Yang X, Li F, Konze KD, Meslamani J, Ma A, Brown PJ, Zhou MM, Arrowsmith CH, Kaniskan HÜ, Vedadi M, Jin J.. (2016) Structure-Activity Relationship Studies for Enhancer of Zeste Homologue 2 (EZH2) and Enhancer of Zeste Homologue 1 (EZH1) Inhibitors., 59 (16): [PMID:27468126 ] [10.1021/acs.jmedchem.6b00855 ]