rac-3-(1-Acetyl-5-(4'-methoxy-[1,1'-biphenyl]-4-yl)-4,5-dihydro-1H-pyrazol-3-yl)-6-chloro-4-phenylquinolin-2(1H)-one

ID: ALA4533313

PubChem CID: 155547239

Max Phase: Preclinical

Molecular Formula: C33H26ClN3O3

Molecular Weight: 548.04

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc(C3CC(c4c(-c5ccccc5)c5cc(Cl)ccc5[nH]c4=O)=NN3C(C)=O)cc2)cc1

Standard InChI:  InChI=1S/C33H26ClN3O3/c1-20(38)37-30(23-10-8-21(9-11-23)22-12-15-26(40-2)16-13-22)19-29(36-37)32-31(24-6-4-3-5-7-24)27-18-25(34)14-17-28(27)35-33(32)39/h3-18,30H,19H2,1-2H3,(H,35,39)

Standard InChI Key:  BMZWJRCKOKXBGT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 45  0  0  0  0  0  0  0  0999 V2000
   15.4079  -20.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4067  -21.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1187  -21.7824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1169  -20.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8335  -20.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8324  -21.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5466  -21.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2666  -21.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2678  -20.5412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5490  -20.1212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5495  -19.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2669  -18.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2672  -18.0642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5510  -17.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8328  -18.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8359  -18.8915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9824  -20.1271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7365  -20.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2878  -19.8536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8787  -19.1369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.0703  -19.3059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9812  -21.7835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2146  -18.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0362  -18.2989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7332  -17.7128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1115  -19.8498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5269  -20.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3498  -20.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7570  -19.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3395  -19.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5180  -19.1370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6952  -20.1338    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   23.5746  -19.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9891  -20.5503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8101  -20.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2175  -19.8311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7980  -19.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9785  -19.1276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0392  -19.8251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.4553  -20.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 10 11  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 17  2  0
  9 17  1  0
  8 22  2  0
 20 23  1  0
 23 24  1  0
 23 25  2  0
 19 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  1 32  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 29 33  1  0
 36 39  1  0
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533313

    ---

Associated Targets(Human)

RAD51 Tchem DNA repair protein RAD51 homolog 1 (504 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 548.04Molecular Weight (Monoisotopic): 547.1663AlogP: 7.22#Rotatable Bonds: 5
Polar Surface Area: 74.76Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.88CX Basic pKa: CX LogP: 6.41CX LogD: 6.41
Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.75

References

1. Bagnolini G, Milano D, Manerba M, Schipani F, Ortega JA, Gioia D, Falchi F, Balboni A, Farabegoli F, De Franco F, Robertson J, Pellicciari R, Pallavicini I, Peri S, Minucci S, Girotto S, Di Stefano G, Roberti M, Cavalli A..  (2020)  Synthetic Lethality in Pancreatic Cancer: Discovery of a New RAD51-BRCA2 Small Molecule Disruptor That Inhibits Homologous Recombination and Synergizes with Olaparib.,  63  (5): [PMID:32037829] [10.1021/acs.jmedchem.9b01526]

Source