The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-3-(1-Acetyl-5-(4'-methoxy-[1,1'-biphenyl]-4-yl)-4,5-dihydro-1H-pyrazol-3-yl)-6-chloro-4-phenylquinolin-2(1H)-one ID: ALA4533313
PubChem CID: 155547239
Max Phase: Preclinical
Molecular Formula: C33H26ClN3O3
Molecular Weight: 548.04
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(C3CC(c4c(-c5ccccc5)c5cc(Cl)ccc5[nH]c4=O)=NN3C(C)=O)cc2)cc1
Standard InChI: InChI=1S/C33H26ClN3O3/c1-20(38)37-30(23-10-8-21(9-11-23)22-12-15-26(40-2)16-13-22)19-29(36-37)32-31(24-6-4-3-5-7-24)27-18-25(34)14-17-28(27)35-33(32)39/h3-18,30H,19H2,1-2H3,(H,35,39)
Standard InChI Key: BMZWJRCKOKXBGT-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
15.4079 -20.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4067 -21.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1187 -21.7824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1169 -20.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8335 -20.5392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8324 -21.3686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5466 -21.7800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2666 -21.3706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2678 -20.5412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5490 -20.1212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5495 -19.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2669 -18.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2672 -18.0642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5510 -17.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8328 -18.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8359 -18.8915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9824 -20.1271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7365 -20.4671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2878 -19.8536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8787 -19.1369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0703 -19.3059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9812 -21.7835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2146 -18.3828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0362 -18.2989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7332 -17.7128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1115 -19.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5269 -20.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3498 -20.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7570 -19.8443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3395 -19.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5180 -19.1370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6952 -20.1338 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.5746 -19.8395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9891 -20.5503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8101 -20.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2175 -19.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7980 -19.1196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9785 -19.1276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0392 -19.8251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4553 -20.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
10 11 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 17 2 0
9 17 1 0
8 22 2 0
20 23 1 0
23 24 1 0
23 25 2 0
19 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
1 32 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
29 33 1 0
36 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.04Molecular Weight (Monoisotopic): 547.1663AlogP: 7.22#Rotatable Bonds: 5Polar Surface Area: 74.76Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.88CX Basic pKa: ┄CX LogP: 6.41CX LogD: 6.41Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.25Np Likeness Score: -0.75
References 1. Bagnolini G, Milano D, Manerba M, Schipani F, Ortega JA, Gioia D, Falchi F, Balboni A, Farabegoli F, De Franco F, Robertson J, Pellicciari R, Pallavicini I, Peri S, Minucci S, Girotto S, Di Stefano G, Roberti M, Cavalli A.. (2020) Synthetic Lethality in Pancreatic Cancer: Discovery of a New RAD51-BRCA2 Small Molecule Disruptor That Inhibits Homologous Recombination and Synergizes with Olaparib., 63 (5): [PMID:32037829 ] [10.1021/acs.jmedchem.9b01526 ]