1-benzyl-7,7-dimethyl-4-(4-nitrophenyl)-5-oxo-5,6,7,8-tetrahydro-1H-pyrrolo[2,3-b]quinoline-3-carbonitrile

ID: ALA4533325

PubChem CID: 129908048

Max Phase: Preclinical

Molecular Formula: C27H22N4O3

Molecular Weight: 450.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C)CC(=O)c2c(nc3c(c(C#N)cn3Cc3ccccc3)c2-c2ccc([N+](=O)[O-])cc2)C1

Standard InChI:  InChI=1S/C27H22N4O3/c1-27(2)12-21-25(22(32)13-27)23(18-8-10-20(11-9-18)31(33)34)24-19(14-28)16-30(26(24)29-21)15-17-6-4-3-5-7-17/h3-11,16H,12-13,15H2,1-2H3

Standard InChI Key:  UBHATHZNKCMKPJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   33.7236   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9779   -3.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3150   -2.9262    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9064   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6566   -3.4093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8615   -3.2392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3644   -4.7877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5699   -4.6212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3181   -3.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5238   -3.6751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9758   -4.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2276   -5.0564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0275   -5.2287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2038   -4.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6834   -5.5068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.3132   -2.1090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6046   -1.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6052   -0.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8974   -0.4782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1896   -0.8884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1940   -1.7098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9023   -2.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2807   -6.0057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.1795   -4.4863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5592   -3.5659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6173   -5.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0698   -6.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3232   -6.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1236   -7.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6702   -6.5025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4139   -5.7287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3800   -7.8933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.1799   -8.0607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.8351   -8.5023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  1  2  2  0
  2  3  1  0
  3  5  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 14 15  3  0
  1 14  1  0
  3 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 13 23  2  0
 11 24  1  0
 11 25  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
  7 26  1  0
 32 33  2  0
 32 34  1  0
 29 32  1  0
M  CHG  2  32   1  34  -1
M  END

Alternative Forms

  1. Parent:

    ALA4533325

    ---

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 reverse transcriptase (18245 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.50Molecular Weight (Monoisotopic): 450.1692AlogP: 5.69#Rotatable Bonds: 4
Polar Surface Area: 101.82Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 1.27CX LogP: 5.38CX LogD: 5.38
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.29Np Likeness Score: -0.99

References

1. Stanton RA, Lu X, Detorio M, Montero C, Hammond ET, Ehteshami M, Domaoal RA, Nettles JH, Feraud M, Schinazi RF..  (2016)  Discovery, characterization, and lead optimization of 7-azaindole non-nucleoside HIV-1 reverse transcriptase inhibitors.,  26  (16): [PMID:27390064] [10.1016/j.bmcl.2016.06.065]

Source