The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(1-(1-(4-Chloro-3-(trifluoromethyl)benzoyl)piperidin-4-yl)-1H-imidazol-5-yl)phenyl Naphthalene-1-sulfonate ID: ALA4533569
PubChem CID: 142737912
Max Phase: Preclinical
Molecular Formula: C32H25ClF3N3O4S
Molecular Weight: 640.08
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccc(Cl)c(C(F)(F)F)c1)N1CCC(n2cncc2-c2ccc(OS(=O)(=O)c3cccc4ccccc34)cc2)CC1
Standard InChI: InChI=1S/C32H25ClF3N3O4S/c33-28-13-10-23(18-27(28)32(34,35)36)31(40)38-16-14-24(15-17-38)39-20-37-19-29(39)22-8-11-25(12-9-22)43-44(41,42)30-7-3-5-21-4-1-2-6-26(21)30/h1-13,18-20,24H,14-17H2
Standard InChI Key: CXSPZGULMKVPCE-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 49 0 0 0 0 0 0 0 0999 V2000
11.4840 -5.5904 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0169 -6.2278 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.3024 -5.4476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9216 -11.1020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2100 -10.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2223 -9.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9422 -9.4523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6539 -9.8749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6416 -10.6998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3491 -11.1181 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.5148 -9.4319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7950 -9.8342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5231 -8.6070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8156 -8.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8279 -7.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5478 -6.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2553 -7.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2429 -8.2048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5560 -6.1323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8963 -5.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1608 -4.8590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9857 -4.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2311 -5.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0106 -5.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6338 -5.3765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4133 -5.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5736 -6.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3570 -6.7192 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7347 -6.6392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7388 -7.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0252 -7.8805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0278 -8.7036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7402 -9.1138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4551 -8.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4510 -7.8765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1646 -7.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1619 -6.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4483 -6.2249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9545 -6.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1709 -6.7307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9135 -11.9291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9036 -12.6797 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.2381 -12.4650 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.5745 -12.4826 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
4 9 1 0
9 10 1 0
6 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
19 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 2 1 0
2 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
29 38 1 0
27 39 1 0
39 40 2 0
24 40 1 0
41 42 1 0
41 43 1 0
41 44 1 0
4 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 640.08Molecular Weight (Monoisotopic): 639.1206AlogP: 7.62#Rotatable Bonds: 6Polar Surface Area: 81.50Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.44CX LogP: 6.44CX LogD: 6.41Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.18Np Likeness Score: -1.25
References 1. Park JH, Williams DR, Lee JH, Lee SD, Lee JH, Ko H, Lee GE, Kim S, Lee JM, Abdelrahman A, Müller CE, Jung DW, Kim YC.. (2016) Potent Suppressive Effects of 1-Piperidinylimidazole Based Novel P2X7 Receptor Antagonists on Cancer Cell Migration and Invasion., 59 (16): [PMID:27427902 ] [10.1021/acs.jmedchem.5b01690 ]