rac-4-(3-((4-(Cyano(cyclopentyl)(phenyl)methyl)piperidin-1-yl)methyl)azetidin-1-yl)benzonitrile

ID: ALA4533602

PubChem CID: 132104133

Max Phase: Preclinical

Molecular Formula: C29H34N4

Molecular Weight: 438.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#Cc1ccc(N2CC(CN3CCC(C(C#N)(c4ccccc4)C4CCCC4)CC3)C2)cc1

Standard InChI:  InChI=1S/C29H34N4/c30-18-23-10-12-28(13-11-23)33-20-24(21-33)19-32-16-14-27(15-17-32)29(22-31,26-8-4-5-9-26)25-6-2-1-3-7-25/h1-3,6-7,10-13,24,26-27H,4-5,8-9,14-17,19-21H2

Standard InChI Key:  CYEDNGNZORFGTK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    9.4458   -5.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4447   -5.8630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1527   -6.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8624   -5.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8595   -5.0398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1509   -4.6346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1485   -3.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4396   -3.4109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4397   -2.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7349   -2.1883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0260   -2.5956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0264   -3.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7358   -3.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8550   -3.4067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6029   -3.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1479   -3.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7371   -2.4195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9383   -2.5919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1406   -2.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3186   -2.1864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6105   -2.5944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8205   -2.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6084   -3.1680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3976   -3.3801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9034   -3.5746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1957   -3.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4882   -3.5710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4871   -4.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1994   -4.7981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9041   -4.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7788   -4.8014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0713   -5.2104    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1327   -2.1753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  7 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
  7 19  1  0
 11 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 21  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 23 25  1  0
 31 32  3  0
 28 31  1  0
 19 33  3  0
M  END

Alternative Forms

  1. Parent:

    ALA4533602

    ---

Associated Targets(Human)

MEN1 Tchem Menin (447 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MV4-11 (7307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.62Molecular Weight (Monoisotopic): 438.2783AlogP: 5.36#Rotatable Bonds: 6
Polar Surface Area: 54.06Molecular Species: BASEHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.24CX LogP: 5.55CX LogD: 3.71
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.61Np Likeness Score: -1.14

References

1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S..  (2019)  Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction.,  62  (13): [PMID:31244110] [10.1021/acs.jmedchem.9b00021]

Source