1-Benzyl-4-(2-fluorophenyl)-5-methylene-1,5-dihydro-2H-pyrrol-2-one

ID: ALA4533617

PubChem CID: 155547427

Max Phase: Preclinical

Molecular Formula: C18H14FNO

Molecular Weight: 279.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(c2ccccc2F)=CC(=O)N1Cc1ccccc1

Standard InChI:  InChI=1S/C18H14FNO/c1-13-16(15-9-5-6-10-17(15)19)11-18(21)20(13)12-14-7-3-2-4-8-14/h2-11H,1,12H2

Standard InChI Key:  QPRKRDTTXMKRCR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
   12.8301  -17.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8290  -18.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5370  -18.7774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2467  -18.3680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2439  -17.5453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5352  -17.1401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1210  -18.7765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3792  -18.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8319  -19.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2400  -19.7576    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0394  -19.5883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0193  -18.9635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6478  -20.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1223  -17.1405    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.9071  -20.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0943  -20.5888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6166  -19.9271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8045  -20.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4709  -20.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9553  -21.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7657  -21.3340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  9 12  2  0
 11 13  2  0
  1 14  1  0
 10 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533617

    ---

Associated Targets(non-human)

Pseudomonas aeruginosa (123386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 279.31Molecular Weight (Monoisotopic): 279.1059AlogP: 3.77#Rotatable Bonds: 3
Polar Surface Area: 20.31Molecular Species: NEUTRALHBA: 1HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.40CX LogD: 3.40
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.84Np Likeness Score: -0.54

References

1. Almohaywi B, Yu TT, Iskander G, Chan DSH, Ho KKK, Rice S, Black DS, Griffith R, Kumar N..  (2019)  Dihydropyrrolones as bacterial quorum sensing inhibitors.,  29  (9): [PMID:30857746] [10.1016/j.bmcl.2019.03.004]

Source