7-((2,4-Difluorophenyl)sulfonyl)-N-(m-tolyl)-5,6,7,8-tetrahydropyrido[4',3':4,5]thieno[2,3-d]pyrimidin-4-amine

ID: ALA4533624

PubChem CID: 155547431

Max Phase: Preclinical

Molecular Formula: C22H18F2N4O2S2

Molecular Weight: 472.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(Nc2ncnc3sc4c(c23)CCN(S(=O)(=O)c2ccc(F)cc2F)C4)c1

Standard InChI:  InChI=1S/C22H18F2N4O2S2/c1-13-3-2-4-15(9-13)27-21-20-16-7-8-28(11-18(16)31-22(20)26-12-25-21)32(29,30)19-6-5-14(23)10-17(19)24/h2-6,9-10,12H,7-8,11H2,1H3,(H,25,26,27)

Standard InChI Key:  VPWMNSXABBKDCN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   40.1167   -6.0753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1208   -5.2581    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   39.4110   -5.6631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.7501   -3.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7490   -4.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4570   -4.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1667   -4.0465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.1639   -3.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4552   -2.8186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0409   -4.4550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.0403   -5.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0391   -6.9051    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.7495   -6.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7470   -5.6776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.3312   -6.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3281   -5.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5561   -6.7502    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   42.0739   -6.0919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5524   -5.4345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2242   -4.6954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4164   -4.6076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9381   -5.2646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.2671   -6.0103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7171   -4.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1339   -3.8449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7308   -3.1350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9127   -3.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4995   -3.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9050   -4.5460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9511   -3.8524    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.5080   -2.4191    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   45.4528   -2.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  5 10  1  0
 10 11  1  0
 11 16  2  0
 15 12  2  0
 12 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  1  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22  2  1  0
  2 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 25 30  1  0
 27 31  1  0
  9 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533624

    ---

Associated Targets(Human)

SUNE1 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MKNK1 Tchem MAP kinase-interacting serine/threonine-protein kinase MNK1 (2071 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.54Molecular Weight (Monoisotopic): 472.0839AlogP: 4.77#Rotatable Bonds: 4
Polar Surface Area: 75.19Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.54CX LogP: 5.08CX LogD: 5.08
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.46Np Likeness Score: -2.53

References

1. Zhang M, Jiang L, Tao J, Pan Z, He M, Su D, He G, Jiang Q..  (2019)  Design, synthesis and biological evaluation of 4-aniline-thieno[2,3-d]pyrimidine derivatives as MNK1 inhibitors against renal cell carcinoma and nasopharyngeal carcinoma.,  27  (11): [PMID:31014565] [10.1016/j.bmc.2019.04.022]

Source