The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-bromobenzyloxy)-2-nitrobenzoyl)-3-hydroxycyclohex-2-en-1-one ID: ALA4533679
PubChem CID: 155547096
Max Phase: Preclinical
Molecular Formula: C20H16BrNO6
Molecular Weight: 446.25
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CCCC(O)=C1C(=O)c1cccc(OCc2ccc(Br)cc2)c1[N+](=O)[O-]
Standard InChI: InChI=1S/C20H16BrNO6/c21-13-9-7-12(8-10-13)11-28-17-6-1-3-14(19(17)22(26)27)20(25)18-15(23)4-2-5-16(18)24/h1,3,6-10,23H,2,4-5,11H2
Standard InChI Key: QUIYDFAODLRSRO-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
1.1515 -4.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9896 -3.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9885 -4.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6965 -5.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4062 -4.6945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4033 -3.8718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6947 -3.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2818 -3.4670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2816 -2.6498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5742 -3.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8645 -3.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1590 -3.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8627 -5.0937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5743 -4.6868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8679 -2.6431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2812 -5.0968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1095 -3.4606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8187 -3.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5249 -3.4552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2326 -3.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9383 -3.4540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9356 -2.6359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2214 -2.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5186 -2.6431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6923 -2.6494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6412 -2.2237 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.3988 -2.2387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9834 -2.2429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
2 8 1 0
8 9 2 0
8 10 1 0
10 11 2 0
10 14 1 0
11 12 1 0
12 1 1 0
1 13 1 0
13 14 1 0
11 15 1 0
14 16 2 0
6 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
7 25 1 0
22 26 1 0
25 27 1 0
25 28 2 0
M CHG 2 25 1 27 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.25Molecular Weight (Monoisotopic): 445.0161AlogP: 4.68#Rotatable Bonds: 6Polar Surface Area: 106.74Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.00CX Basic pKa: ┄CX LogP: 4.28CX LogD: 1.12Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.30Np Likeness Score: -0.32
References 1. Ndikuryayo F, Kang WM, Wu FX, Yang WC, Yang GF.. (2019) Hydrophobicity-oriented drug design (HODD) of new human 4-hydroxyphenylpyruvate dioxygenase inhibitors., 166 [PMID:30684868 ] [10.1016/j.ejmech.2019.01.032 ]