The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(cyclopropylmethyl)pyrrolidin-3-yl)-5-((2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl)methyl)-2-fluorobenzamide ID: ALA4533690
PubChem CID: 141726120
Max Phase: Preclinical
Molecular Formula: C24H25FN4O3
Molecular Weight: 436.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1CCN(CC2CC2)C1)c1cc(Cn2c(=O)[nH]c(=O)c3ccccc32)ccc1F
Standard InChI: InChI=1S/C24H25FN4O3/c25-20-8-7-16(13-29-21-4-2-1-3-18(21)22(30)27-24(29)32)11-19(20)23(31)26-17-9-10-28(14-17)12-15-5-6-15/h1-4,7-8,11,15,17H,5-6,9-10,12-14H2,(H,26,31)(H,27,30,32)
Standard InChI Key: ZKLQWWOVTJLLRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
15.9710 -25.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9698 -26.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6779 -26.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6761 -25.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3847 -25.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3835 -26.5461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0897 -26.9552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8016 -26.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8028 -25.7275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0920 -25.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0921 -24.4967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0874 -27.7724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7940 -28.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7904 -28.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4961 -29.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2059 -29.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2056 -28.1814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4993 -27.7746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9130 -29.4124 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.9130 -27.7723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9124 -26.9551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5082 -26.9587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6223 -28.1765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3277 -27.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1011 -28.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5817 -27.3542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1016 -26.6929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3244 -26.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3989 -27.3546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8072 -28.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8081 -28.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5160 -28.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
7 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
17 20 1 0
20 23 1 0
20 21 2 0
8 22 2 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
26 29 1 0
29 30 1 0
31 30 1 0
32 31 1 0
30 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 436.49Molecular Weight (Monoisotopic): 436.1911AlogP: 2.09#Rotatable Bonds: 6Polar Surface Area: 87.20Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.65CX Basic pKa: 8.54CX LogP: 2.07CX LogD: 1.09Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -1.89
References 1. Jain PG, Patel BD.. (2019) Medicinal chemistry approaches of poly ADP-Ribose polymerase 1 (PARP1) inhibitors as anticancer agents - A recent update., 165 [PMID:30684797 ] [10.1016/j.ejmech.2019.01.024 ] 2. Liu T, Song S, Wang X, Hao J.. (2021) Small-molecule inhibitors of breast cancer-related targets: Potential therapeutic agents for breast cancer., 210 [PMID:33158576 ] [10.1016/j.ejmech.2020.112954 ] 3. Bansal R, Malhotra A.. (2021) Therapeutic progression of quinazolines as targeted chemotherapeutic agents., 211 [PMID:33243532 ] [10.1016/j.ejmech.2020.113016 ] 4. Zhang J, Gao Y, Zhang Z, Zhao J, Jia W, Xia C, Wang F, Liu T.. (2022) Multi-therapies Based on PARP Inhibition: Potential Therapeutic Approaches for Cancer Treatment., 65 (24.0): [PMID:36512711 ] [10.1021/acs.jmedchem.2c01352 ]