The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-(5-cyano-4-((1-methoxypropan-2-yl)oxy)pyridin-2-yl)-7-formyl-6-((3-oxomorpholino)methyl)-3,4-dihydro-1,8-naphthyridine-1(2H)-carboxamide ID: ALA4533697
PubChem CID: 155547256
Max Phase: Preclinical
Molecular Formula: C25H28N6O6
Molecular Weight: 508.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COC[C@@H](C)Oc1cc(NC(=O)N2CCCc3cc(CN4CCOCC4=O)c(C=O)nc32)ncc1C#N
Standard InChI: InChI=1S/C25H28N6O6/c1-16(14-35-2)37-21-9-22(27-11-19(21)10-26)29-25(34)31-5-3-4-17-8-18(20(13-32)28-24(17)31)12-30-6-7-36-15-23(30)33/h8-9,11,13,16H,3-7,12,14-15H2,1-2H3,(H,27,29,34)/t16-/m1/s1
Standard InChI Key: JENZFUYEUWQEJI-MRXNPFEDSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
3.9772 -10.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9761 -10.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6841 -11.3649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6823 -9.7276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3910 -10.1328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3898 -10.9580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0999 -11.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8157 -10.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8169 -10.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1022 -9.7190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1023 -8.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8100 -8.4932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5177 -8.9019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3946 -8.4932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2694 -9.7280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2692 -8.9108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5129 -9.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2197 -10.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9285 -9.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9259 -8.8992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2184 -8.4944 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6309 -10.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3391 -10.5378 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2193 -10.9464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9268 -11.3554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9264 -12.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6339 -12.5816 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6334 -13.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2681 -11.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2674 -12.1812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5600 -12.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5574 -13.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2629 -13.8149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9728 -13.4081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9770 -12.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8532 -12.1781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.6347 -10.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
11 14 2 0
1 15 1 0
15 16 2 0
13 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 13 1 0
22 23 3 0
19 22 1 0
18 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
2 29 1 0
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
31 36 2 0
25 37 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.54Molecular Weight (Monoisotopic): 508.2070AlogP: 1.92#Rotatable Bonds: 8Polar Surface Area: 146.98Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.87CX Basic pKa: 2.20CX LogP: 1.50CX LogD: 1.50Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: -1.15
References 1. Sun C, Fang L, Zhang X, Gao P, Gou S.. (2019) Novel 7-formyl-naphthyridyl-ureas derivatives as potential selective FGFR4 inhibitors: Design, synthesis, and biological activity studies., 27 (10): [PMID:30987781 ] [10.1016/j.bmc.2019.04.018 ]