The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-((4-isothiocyanatobutyl)thio)acetamido)phenyl ethyl(methyl)carbamate ID: ALA4533772
PubChem CID: 155547322
Max Phase: Preclinical
Molecular Formula: C17H23N3O3S2
Molecular Weight: 381.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(C)C(=O)Oc1cccc(NC(=O)CSCCCCN=C=S)c1
Standard InChI: InChI=1S/C17H23N3O3S2/c1-3-20(2)17(22)23-15-8-6-7-14(11-15)19-16(21)12-25-10-5-4-9-18-13-24/h6-8,11H,3-5,9-10,12H2,1-2H3,(H,19,21)
Standard InChI Key: LBPNPZPJFRQLJN-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 25 0 0 0 0 0 0 0 0999 V2000
28.7323 -1.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7312 -2.3796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4392 -2.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1489 -2.3791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1461 -1.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4375 -1.1512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8573 -2.7866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5643 -2.3769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2727 -2.7844 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5630 -1.5597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2740 -3.6016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9797 -2.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0232 -2.7876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3158 -2.3785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6078 -2.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3164 -1.5613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.9004 -2.3774 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
25.1923 -2.7854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4850 -2.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7769 -2.7843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0695 -2.3751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3615 -2.7831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.6881 -2.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6541 -2.3740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9416 -1.9646 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
9 12 1 0
2 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
12 23 1 0
22 24 2 0
24 25 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 381.52Molecular Weight (Monoisotopic): 381.1181AlogP: 3.69#Rotatable Bonds: 10Polar Surface Area: 71.00Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.27CX Basic pKa: 0.89CX LogP: 3.27CX LogD: 3.27Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.38Np Likeness Score: -1.45
References 1. Sestito S, Pruccoli L, Runfola M, Citi V, Martelli A, Saccomanni G, Calderone V, Tarozzi A, Rapposelli S.. (2019) Design and synthesis of H2 S-donor hybrids: A new treatment for Alzheimer's disease?, 184 [PMID:31585237 ] [10.1016/j.ejmech.2019.111745 ]