3-(((2,4-dimethylphenyl)(methoxy)phosphoryl)(isopropyl)amino)-5-(4-fluorophenyl)thiophene-2-carboxylic acid

ID: ALA4533843

PubChem CID: 155547041

Max Phase: Preclinical

Molecular Formula: C23H25FNO4PS

Molecular Weight: 461.50

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COP(=O)(c1ccc(C)cc1C)N(c1cc(-c2ccc(F)cc2)sc1C(=O)O)C(C)C

Standard InChI:  InChI=1S/C23H25FNO4PS/c1-14(2)25(30(28,29-5)20-11-6-15(3)12-16(20)4)19-13-21(31-22(19)23(26)27)17-7-9-18(24)10-8-17/h6-14H,1-5H3,(H,26,27)

Standard InChI Key:  SGWMOZFWPXVBAG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   15.2988  -20.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9460  -21.1307    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.6216  -20.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3909  -19.8842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5748  -19.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3906  -20.9457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5356  -21.7511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3041  -22.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9283  -21.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7789  -20.6902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0105  -20.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5123  -20.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9215  -20.2979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3188  -21.6564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1131  -19.1897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4657  -18.4528    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   16.2826  -18.4766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0044  -17.7784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6475  -18.4446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.6980  -21.7724    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   16.6665  -19.1957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4826  -19.2197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9124  -18.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5202  -17.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7054  -17.7814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7293  -18.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3139  -17.0641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2461  -17.7328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2983  -19.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8365  -18.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9454  -19.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3  6  1  0
 12 13  1  0
 12 14  2  0
  1 12  1  0
  5 15  1  0
 15 16  1  0
 17 16  1  0
 16 18  2  0
 16 19  1  0
  9 20  1  0
 17 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 17  1  0
 23 26  1  0
 25 27  1  0
 19 28  1  0
 15 29  1  0
 29 30  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533843

    ---

Associated Targets(non-human)

Hepatitis C virus (23859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Genome polyprotein (55 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.50Molecular Weight (Monoisotopic): 461.1226AlogP: 6.25#Rotatable Bonds: 7
Polar Surface Area: 66.84Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.25CX Basic pKa: CX LogP: 5.81CX LogD: 2.26
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -0.95

References

1. Pierra Rouvière C, Amador A, Badaroux E, Convard T, Da Costa D, Dukhan D, Griffe L, Griffon JF, LaColla M, Leroy F, Liuzzi M, Loi AG, McCarville J, Mascia V, Milhau J, Onidi L, Paparin JL, Rahali R, Sais E, Seifer M, Surleraux D, Standring D, Dousson C..  (2016)  Synthesis of potent and broad genotypically active NS5B HCV non-nucleoside inhibitors binding to the thumb domain allosteric site 2 of the viral polymerase.,  26  (18): [PMID:27520942] [10.1016/j.bmcl.2016.01.042]

Source