The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-(6-(pyrrolidin-1-yl)pyridin-3-yl)-1-(3-(trifluoromethyl)phenyl)benzo[h][1,6]naphthyridin-2(1H)-one ID: ALA4533872
PubChem CID: 155249687
Max Phase: Preclinical
Molecular Formula: C28H21F3N4O
Molecular Weight: 486.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1ccc2cnc3ccc(-c4ccc(N5CCCC5)nc4)cc3c2n1-c1cccc(C(F)(F)F)c1
Standard InChI: InChI=1S/C28H21F3N4O/c29-28(30,31)21-4-3-5-22(15-21)35-26(36)11-8-20-17-32-24-9-6-18(14-23(24)27(20)35)19-7-10-25(33-16-19)34-12-1-2-13-34/h3-11,14-17H,1-2,12-13H2
Standard InChI Key: BTUXMCBWFVNMFR-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
30.1150 -16.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1138 -17.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8219 -17.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8201 -16.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5287 -16.7158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5295 -17.5348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2380 -17.9418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9463 -17.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4092 -16.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4104 -15.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7034 -15.0845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9948 -15.4933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9976 -16.3147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.7052 -16.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5166 -15.0794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5158 -14.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8066 -13.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1003 -14.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1076 -15.0933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8173 -15.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8024 -13.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5080 -12.6298 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.0926 -12.6371 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.7974 -12.2207 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.2277 -16.3013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9381 -16.7076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6412 -16.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6401 -15.4801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9298 -15.0738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2205 -15.4853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9273 -14.2567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2858 -15.0874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.1991 -14.2748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3995 -14.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9920 -14.8146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5398 -15.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 26 1 0
25 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
1 9 1 0
30 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
17 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
25 26 2 0
25 30 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
29 31 2 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 32 1 0
12 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.50Molecular Weight (Monoisotopic): 486.1667AlogP: 6.22#Rotatable Bonds: 3Polar Surface Area: 51.02Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.95CX LogP: 5.69CX LogD: 5.68Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -1.49
References 1. Hao T, Li Y, Fan S, Li W, Wang S, Li S, Cao R, Zhong W.. (2019) Design, synthesis and pharmacological evaluation of a novel mTOR-targeted anti-EV71 agent., 175 [PMID:31082764 ] [10.1016/j.ejmech.2019.04.048 ]