trans-N,N'-(6,6'-((1S,3S)-cyclohexane-1,3-diyl)bis(pyridazine-6,3-diyl))bis(2-(pyridin-2-yl)acetamide)

ID: ALA4533926

PubChem CID: 129135364

Max Phase: Preclinical

Molecular Formula: C28H28N8O2

Molecular Weight: 508.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccccn1)Nc1ccc([C@H]2CCC[C@H](c3ccc(NC(=O)Cc4ccccn4)nn3)C2)nn1

Standard InChI:  InChI=1S/C28H28N8O2/c37-27(17-21-8-1-3-14-29-21)31-25-12-10-23(33-35-25)19-6-5-7-20(16-19)24-11-13-26(36-34-24)32-28(38)18-22-9-2-4-15-30-22/h1-4,8-15,19-20H,5-7,16-18H2,(H,31,35,37)(H,32,36,38)/t19-,20-/m0/s1

Standard InChI Key:  NUBDRPQBGZCJGC-PMACEKPBSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   22.8152  -11.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0977  -12.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6737  -12.1732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6737  -12.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3857  -13.4065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0977  -12.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3857  -11.7566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9581  -11.7629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9588  -10.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2439  -10.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5298  -10.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5348  -11.7710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2502  -12.1776    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5321  -12.1749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2491  -11.7612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2495  -10.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5267  -10.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8126  -10.9337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9633  -10.5181    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6783  -10.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3922  -10.5160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6795  -11.7546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8135  -10.5324    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1008  -10.9479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3847  -10.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1044  -11.7729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6719  -10.9539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1073  -10.9275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9572  -10.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2450  -10.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2480  -11.7809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9693  -12.1902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6785  -11.7730    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.1059  -11.7507    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8201  -12.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5350  -11.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5310  -10.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8163  -10.5116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  4  1  0
  3  7  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  3  8  1  6
  2  1  1  1
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18  1  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 11 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  1  0
 21 28  1  0
 27 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 27  1  0
 28 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4533926

    ---

Associated Targets(Human)

GLS Tchem Glutaminase kidney isoform, mitochondrial (16997 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 508.59Molecular Weight (Monoisotopic): 508.2335AlogP: 3.86#Rotatable Bonds: 8
Polar Surface Area: 135.54Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.96CX Basic pKa: 4.63CX LogP: 3.04CX LogD: 3.04
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -0.85

References

1. Zimmermann SC, Duvall B, Tsukamoto T..  (2018)  Recent Progress in the Discovery of Allosteric Inhibitors of Kidney-Type Glutaminase.,  62  (1): [PMID:29969024] [10.1021/acs.jmedchem.8b00327]

Source