The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(dimethylamino)ethyl)-N-(4-(hydroxycarbamoyl)benzyl)-1-(4-methoxyphenyl)-9H-pyrido[3,4-b]indole-3-carboxamide ID: ALA4533956
PubChem CID: 155546987
Max Phase: Preclinical
Molecular Formula: C31H31N5O4
Molecular Weight: 537.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nc(C(=O)N(CCN(C)C)Cc3ccc(C(=O)NO)cc3)cc3c2[nH]c2ccccc23)cc1
Standard InChI: InChI=1S/C31H31N5O4/c1-35(2)16-17-36(19-20-8-10-22(11-9-20)30(37)34-39)31(38)27-18-25-24-6-4-5-7-26(24)32-29(25)28(33-27)21-12-14-23(40-3)15-13-21/h4-15,18,32,39H,16-17,19H2,1-3H3,(H,34,37)
Standard InChI Key: XBDRSVDDESRGNN-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
14.1209 -10.9329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.6342 -10.2780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1038 -9.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7621 -8.8751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9511 -8.8021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4830 -9.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8272 -10.2071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8856 -9.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8921 -10.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6005 -11.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3027 -10.6544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2922 -9.8359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5833 -9.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6093 -11.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9037 -12.2983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9109 -13.1147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6229 -13.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3291 -13.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3185 -12.2831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6314 -14.3347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9281 -14.7508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9945 -9.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7075 -9.8172 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9837 -8.6009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4098 -9.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1228 -9.7986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1312 -10.6138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8434 -11.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5467 -10.5950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5332 -9.7737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8205 -9.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2602 -10.9933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2721 -11.8104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9619 -10.5744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6755 -10.9727 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7183 -10.6343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4313 -11.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4421 -11.8507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1551 -12.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7398 -12.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
8 3 1 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
10 14 1 0
17 20 1 0
20 21 1 0
12 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 2 0
32 34 1 0
34 35 1 0
23 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 537.62Molecular Weight (Monoisotopic): 537.2376AlogP: 4.71#Rotatable Bonds: 9Polar Surface Area: 110.79Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.15CX Basic pKa: 8.36CX LogP: 3.64CX LogD: 2.92Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: -0.87
References 1. Sangwan R, Rajan R, Mandal PK.. (2018) HDAC as onco target: Reviewing the synthetic approaches with SAR study of their inhibitors., 158 [PMID:30245394 ] [10.1016/j.ejmech.2018.08.073 ] 2. Liu W, Liang Y, Si X.. (2020) Hydroxamic acid hybrids as the potential anticancer agents: An Overview., 205 [PMID:32791404 ] [10.1016/j.ejmech.2020.112679 ] 3. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R.. (2021) β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy., 64 (3.0): [PMID:33528252 ] [10.1021/acs.jmedchem.0c01887 ]