The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3R,5S)-5-((4-(3-chloro-4-(pyridin-2-yloxy)phenylamino)thieno[3,2-d]pyrimidin-6-yl)ethynyl)pyrrolidin-3-yl morpholine-4-carboxylate ID: ALA453398
PubChem CID: 25263250
Max Phase: Preclinical
Molecular Formula: C28H25ClN6O4S
Molecular Weight: 577.07
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O[C@H]1CN[C@H](C#Cc2cc3ncnc(Nc4ccc(Oc5ccccn5)c(Cl)c4)c3s2)C1)N1CCOCC1
Standard InChI: InChI=1S/C28H25ClN6O4S/c29-22-14-19(5-7-24(22)39-25-3-1-2-8-30-25)34-27-26-23(32-17-33-27)15-21(40-26)6-4-18-13-20(16-31-18)38-28(36)35-9-11-37-12-10-35/h1-3,5,7-8,14-15,17-18,20,31H,9-13,16H2,(H,32,33,34)/t18-,20-/m1/s1
Standard InChI Key: LJKWMYHCZOUEOQ-UYAOXDASSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
4.7675 2.6492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4819 2.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4819 1.4117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7675 0.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0530 2.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0530 1.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2684 1.1568 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7834 1.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2684 2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7675 0.1742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9584 1.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1334 1.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3084 1.8242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1765 1.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9611 1.4117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9611 2.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1765 2.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6285 0.9268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3822 1.2624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0497 0.7774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4685 2.0828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9634 -0.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6309 -0.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3845 -0.1924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4708 0.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8033 1.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0530 -0.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0530 -1.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3385 -1.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -1.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6240 -0.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3385 0.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3385 -2.3008 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.9096 -1.4758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1951 -1.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4806 -1.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2338 -1.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2338 -0.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4806 0.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1951 -0.2383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18 19 1 0
9 5 1 0
20 19 1 0
4 6 1 0
19 21 2 0
20 22 1 0
4 10 1 0
5 6 2 0
8 11 1 0
1 2 2 0
11 12 3 0
20 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
5 1 1 0
10 27 1 0
13 12 1 6
27 28 2 0
13 14 1 0
28 29 1 0
2 3 1 0
29 30 2 0
30 31 1 0
3 4 2 0
31 32 2 0
32 27 1 0
6 7 1 0
29 33 1 0
14 15 1 0
30 34 1 0
15 16 1 0
34 35 1 0
16 17 1 0
35 36 2 0
17 13 1 0
36 37 1 0
7 8 1 0
37 38 2 0
15 18 1 1
38 39 1 0
8 9 2 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.07Molecular Weight (Monoisotopic): 576.1347AlogP: 4.83#Rotatable Bonds: 5Polar Surface Area: 110.73Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.25CX LogP: 4.65CX LogD: 3.74Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.32Np Likeness Score: -1.21
References 1. Waterson AG, Petrov KG, Hornberger KR, Hubbard RD, Sammond DM, Smith SC, Dickson HD, Caferro TR, Hinkle KW, Stevens KL, Dickerson SH, Rusnak DW, Spehar GM, Wood ER, Griffin RJ, Uehling DE.. (2009) Synthesis and evaluation of aniline headgroups for alkynyl thienopyrimidine dual EGFR/ErbB-2 kinase inhibitors., 19 (5): [PMID:19208477 ] [10.1016/j.bmcl.2009.01.080 ]