4-(4-(4-Bromophenyl)-2-{[6-(4-bromophenyl)-2-ethylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene]hydrazono}thiazol-3-yl)phenol

ID: ALA4534015

PubChem CID: 155546834

Max Phase: Preclinical

Molecular Formula: C28H20Br2N6OS2

Molecular Weight: 680.45

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1nn2c(/C=N/N=c3\scc(-c4ccc(Br)cc4)n3-c3ccc(O)cc3)c(-c3ccc(Br)cc3)nc2s1

Standard InChI:  InChI=1S/C28H20Br2N6OS2/c1-2-25-34-36-23(26(32-27(36)39-25)18-5-9-20(30)10-6-18)15-31-33-28-35(21-11-13-22(37)14-12-21)24(16-38-28)17-3-7-19(29)8-4-17/h3-16,37H,2H2,1H3/b31-15+,33-28-

Standard InChI Key:  WQEUZRAREGDFOU-ZRKJDBAVSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   43.6448  -17.1213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.6263  -15.7785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1539  -16.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4200  -16.0237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.4292  -16.8520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2200  -17.1021    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   45.7012  -16.4257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.2051  -15.7604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.3304  -16.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9050  -15.7556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0775  -15.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6747  -16.4908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1010  -17.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9270  -17.1905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3600  -14.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5473  -14.8352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.2809  -14.0513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4726  -13.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1263  -13.1456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3080  -13.2427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1475  -14.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8666  -14.4534    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   41.5255  -12.4265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3506  -12.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7520  -11.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3294  -10.9884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5012  -11.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1036  -11.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7300  -10.2756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.5253  -16.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.9452  -17.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7502  -12.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9960  -11.8525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4372  -11.2478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6326  -11.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3897  -12.2217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.9502  -12.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0722  -10.8255    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   39.8507  -16.5033    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 19 23  1  0
 26 29  1  0
  7 30  1  0
 30 31  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 20 32  1  0
 35 38  1  0
 12 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4534015

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 680.45Molecular Weight (Monoisotopic): 677.9507AlogP: 7.70#Rotatable Bonds: 6
Polar Surface Area: 80.07Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.43CX Basic pKa: 2.00CX LogP: 8.28CX LogD: 8.27
Aromatic Rings: 6Heavy Atoms: 39QED Weighted: 0.14Np Likeness Score: -1.47

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source