The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-(4-Ethoxyphenyl)-N'-hydroxy-9-(naphthalen-1-yl)-8-oxo-8,9-dihydro-7H-purine-6-carboximidamide ID: ALA4534050
PubChem CID: 155547011
Max Phase: Preclinical
Molecular Formula: C24H20N6O3
Molecular Weight: 440.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(-c2nc(/C(N)=N\O)c3[nH]c(=O)n(-c4cccc5ccccc45)c3n2)cc1
Standard InChI: InChI=1S/C24H20N6O3/c1-2-33-16-12-10-15(11-13-16)22-26-19(21(25)29-32)20-23(28-22)30(24(31)27-20)18-9-5-7-14-6-3-4-8-17(14)18/h3-13,32H,2H2,1H3,(H2,25,29)(H,27,31)
Standard InChI Key: KPVCWUBDOMTXQA-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
16.9957 -5.3474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7053 -4.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7025 -4.1153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9939 -3.7101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2876 -4.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2888 -4.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5083 -3.8625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0247 -4.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5063 -5.1910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2075 -4.5249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.2557 -5.9631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4593 -6.1290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2079 -6.8971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7484 -7.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4137 -5.3455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4101 -6.1630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1176 -6.5704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8257 -6.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8217 -5.3393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1137 -4.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9879 -2.8932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5346 -6.5672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5369 -7.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2458 -7.7909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2772 -2.4898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.6925 -2.4794 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7985 -6.5625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5419 -7.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0791 -7.9362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8730 -7.7731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1269 -6.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5880 -6.3985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5725 -2.9036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 1 0
11 12 2 0
11 27 1 0
12 13 1 0
13 14 2 0
14 28 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
4 21 1 0
18 22 1 0
22 23 1 0
23 24 1 0
21 25 2 0
21 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
25 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 440.46Molecular Weight (Monoisotopic): 440.1597AlogP: 3.42#Rotatable Bonds: 5Polar Surface Area: 131.41Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.17CX Basic pKa: 0.62CX LogP: 4.68CX LogD: 4.67Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.17Np Likeness Score: -1.24
References 1. Huang MR, Hsu YL, Lin TC, Cheng TJ, Li LW, Tseng YW, Chou YS, Liu JH, Pan SH, Fang JM, Wong CH.. (2019) Structure-guided development of purine amide, hydroxamate, and amidoxime for the inhibition of non-small cell lung cancer., 181 [PMID:31376567 ] [10.1016/j.ejmech.2019.07.054 ]