Ethyl 1-(4-toluoyl)-1H-indole-2-carboxylate

ID: ALA4534055

PubChem CID: 155546687

Max Phase: Preclinical

Molecular Formula: C19H17NO3

Molecular Weight: 307.35

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1cc2ccccc2n1C(=O)c1ccc(C)cc1

Standard InChI:  InChI=1S/C19H17NO3/c1-3-23-19(22)17-12-15-6-4-5-7-16(15)20(17)18(21)14-10-8-13(2)9-11-14/h4-12H,3H2,1-2H3

Standard InChI Key:  FZEHZZNCMOVKFD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   22.0353  -17.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5905  -18.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5894  -19.3631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2974  -19.7721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2956  -18.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0043  -18.5400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0045  -19.3632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7875  -19.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2712  -18.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7871  -18.2855    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0884  -18.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4853  -16.9033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7349  -16.1265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1857  -15.5224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3863  -15.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1391  -16.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6900  -17.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8355  -15.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4972  -19.6585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4967  -18.2431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.3144  -19.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7233  -20.3658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8337  -17.3336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  1  0
  9 11  1  0
 10  1  1  0
  1 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 11 19  1  0
 11 20  2  0
 19 21  1  0
 21 22  1  0
  1 23  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4534055

    ---

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 307.35Molecular Weight (Monoisotopic): 307.1208AlogP: 3.81#Rotatable Bonds: 3
Polar Surface Area: 48.30Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.04CX LogD: 4.04
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.69Np Likeness Score: -0.94

References

1. Keček Plešec K, Urbančič D, Gobec M, Pekošak A, Tomašič T, Anderluh M, Mlinarič-Raščan I, Jakopin Ž..  (2016)  Identification of indole scaffold-based dual inhibitors of NOD1 and NOD2.,  24  (21): [PMID:27601373] [10.1016/j.bmc.2016.08.044]

Source