4-((6-(4-(4-Nitrobenzoyl)piperazin-1-yl)-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)methyl)phenyl Isoquinoline-5-sulfonate

ID: ALA4534068

PubChem CID: 142737903

Max Phase: Preclinical

Molecular Formula: C31H26N6O8S

Molecular Weight: 642.65

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc([N+](=O)[O-])cc1)N1CCN(c2cc(=O)[nH]c(=O)n2Cc2ccc(OS(=O)(=O)c3cccc4cnccc34)cc2)CC1

Standard InChI:  InChI=1S/C31H26N6O8S/c38-28-18-29(34-14-16-35(17-15-34)30(39)22-6-8-24(9-7-22)37(41)42)36(31(40)33-28)20-21-4-10-25(11-5-21)45-46(43,44)27-3-1-2-23-19-32-13-12-26(23)27/h1-13,18-19H,14-17,20H2,(H,33,38,40)

Standard InChI Key:  BQWAXBJBNBKJNE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 46 51  0  0  0  0  0  0  0  0999 V2000
   12.7127  -10.6460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1294   -9.9335    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.3040   -9.9289    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2352  -11.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9585  -11.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9827  -10.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2793  -10.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5517  -10.5145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5317  -11.3391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2993   -9.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0227   -8.9008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5959   -8.8653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6159   -8.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9124   -7.6085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1891   -8.0052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1691   -8.8298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8724   -9.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4856   -7.5731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5056   -6.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8022   -6.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8222   -5.4919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0788   -6.7089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0546   -7.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3312   -7.9302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7621   -7.9656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7380   -8.7902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0145   -9.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3112   -8.7547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5877   -9.1472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5636   -9.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8401  -10.3643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1734   -9.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9062   -8.7343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9470   -7.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2515   -7.4660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5168   -7.8411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4796   -8.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7469   -9.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0514   -8.5986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0903   -7.7705    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8249   -7.3953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2670  -10.4039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9946  -10.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2107  -12.5998    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.9139  -13.0313    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.4855  -12.9929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  4  9  1  0
  7 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 12 17  1  0
 15 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 18 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31  2  1  0
  2 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 32 37  1  0
 37 38  1  0
 38 39  2  0
 39 40  1  0
 40 41  2  0
 36 41  1  0
 30 42  1  0
 42 43  2  0
 27 43  1  0
 44 45  2  0
 44 46  1  0
  4 44  1  0
M  CHG  2  44   1  46  -1
M  END

Alternative Forms

  1. Parent:

    ALA4534068

    ---

Associated Targets(Human)

P2RX7 Tchem P2X purinoceptor 7 (5534 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 642.65Molecular Weight (Monoisotopic): 642.1533AlogP: 2.77#Rotatable Bonds: 8
Polar Surface Area: 177.81Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.96CX Basic pKa: 3.20CX LogP: 3.26CX LogD: 3.26
Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.15Np Likeness Score: -1.40

References

1. Park JH, Williams DR, Lee JH, Lee SD, Lee JH, Ko H, Lee GE, Kim S, Lee JM, Abdelrahman A, Müller CE, Jung DW, Kim YC..  (2016)  Potent Suppressive Effects of 1-Piperidinylimidazole Based Novel P2X7 Receptor Antagonists on Cancer Cell Migration and Invasion.,  59  (16): [PMID:27427902] [10.1021/acs.jmedchem.5b01690]

Source