The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Chloro-8-(4-chlorophenylthio)-3-nitro-2-(phenylsulfonylmethyl)imidazo[1,2-a]pyridine ID: ALA4534157
PubChem CID: 155546793
Max Phase: Preclinical
Molecular Formula: C20H13Cl2N3O4S2
Molecular Weight: 494.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=[N+]([O-])c1c(CS(=O)(=O)c2ccccc2)nc2c(Sc3ccc(Cl)cc3)cc(Cl)cn12
Standard InChI: InChI=1S/C20H13Cl2N3O4S2/c21-13-6-8-15(9-7-13)30-18-10-14(22)11-24-19(18)23-17(20(24)25(26)27)12-31(28,29)16-4-2-1-3-5-16/h1-11H,12H2
Standard InChI Key: GMELBBZUKRQOIY-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
18.7360 -11.8082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4764 -12.1629 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
19.4134 -11.3444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5844 -12.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5844 -13.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2897 -13.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2897 -12.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9950 -12.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9995 -13.2948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7790 -13.5434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2564 -12.8788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7717 -12.2196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2897 -11.2467 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.8773 -13.7034 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.0397 -14.3220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.8399 -14.4875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.4962 -14.9323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0735 -12.8742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2954 -12.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7041 -12.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5205 -12.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9260 -12.1529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5090 -11.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6940 -11.4528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5820 -10.8381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5864 -10.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8796 -9.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1709 -10.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1735 -10.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8810 -11.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4626 -9.6123 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 7 2 0
5 6 2 0
6 9 1 0
8 7 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 2 0
7 13 1 0
5 14 1 0
15 16 2 0
15 17 1 0
10 15 1 0
11 18 1 0
18 2 1 0
2 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
13 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
M CHG 2 15 1 17 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.38Molecular Weight (Monoisotopic): 492.9725AlogP: 5.67#Rotatable Bonds: 6Polar Surface Area: 94.58Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.02CX Basic pKa: 0.92CX LogP: 5.29CX LogD: 5.29Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.25Np Likeness Score: -1.70
References 1. Fersing C, Basmaciyan L, Boudot C, Pedron J, Hutter S, Cohen A, Castera-Ducros C, Primas N, Laget M, Casanova M, Bourgeade-Delmas S, Piednoel M, Sournia-Saquet A, Belle Mbou V, Courtioux B, Boutet-Robinet É, Since M, Milne R, Wyllie S, Fairlamb AH, Valentin A, Rathelot P, Verhaeghe P, Vanelle P, Azas N.. (2019) Nongenotoxic 3-Nitroimidazo[1,2-a ]pyridines Are NTR1 Substrates That Display Potent in Vitro Antileishmanial Activity., 10 (1): [PMID:30655943 ] [10.1021/acsmedchemlett.8b00347 ] 2. Fersing C,Boudot C,Castera-Ducros C,Pinault E,Hutter S,Paoli-Lombardo R,Primas N,Pedron J,Seguy L,Bourgeade-Delmas S,Sournia-Saquet A,Stigliani JL,Brossas JY,Paris L,Valentin A,Wyllie S,Fairlamb AH,Boutet-Robinet É,Corvaisier S,Since M,Malzert-Fréon A,Destere A,Mazier D,Rathelot P,Courtioux B,Azas N,Verhaeghe P,Vanelle P. (2020) 8-Alkynyl-3-nitroimidazopyridines display potent antitrypanosomal activity against both T. b. brucei and cruzi., 202 [PMID:32652409 ] [10.1016/j.ejmech.2020.112558 ]