(Z)-2-((E)-((6-(4-bromophenyl)-2-ethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylene)hydrazono)-3-(4-hydroxyphenyl)-5-methylthiazolidin-4-one

ID: ALA4534243

PubChem CID: 155546725

Max Phase: Preclinical

Molecular Formula: C23H19BrN6O2S2

Molecular Weight: 555.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1nn2c(/C=N/N=C3\SC(C)C(=O)N3c3ccc(O)cc3)c(-c3ccc(Br)cc3)nc2s1

Standard InChI:  InChI=1S/C23H19BrN6O2S2/c1-3-19-28-30-18(20(26-22(30)34-19)14-4-6-15(24)7-5-14)12-25-27-23-29(21(32)13(2)33-23)16-8-10-17(31)11-9-16/h4-13,31H,3H2,1-2H3/b25-12+,27-23-

Standard InChI Key:  KMVFDVLZZYCPJS-IVVNBYSSSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    7.9547  -25.0293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9363  -23.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4646  -24.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7286  -23.9335    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7378  -24.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5273  -25.0101    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.0077  -24.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5125  -23.6706    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6425  -24.3784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2178  -23.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3917  -23.6770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9895  -24.3998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4152  -25.1130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2398  -25.0984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6704  -22.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8591  -22.7471    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5931  -21.9644    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7817  -21.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4293  -21.0583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6083  -21.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4493  -21.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1720  -22.3685    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.0486  -20.5493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8244  -20.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6482  -20.3284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0464  -19.6093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6221  -18.9034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7953  -18.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4008  -19.6406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0196  -18.1831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7034  -22.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1669  -24.4124    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   10.8305  -24.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2497  -25.0337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 20 23  2  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 19 24  1  0
 27 30  1  0
 21 31  1  0
 12 32  1  0
  7 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4534243

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.48Molecular Weight (Monoisotopic): 554.0194AlogP: 5.35#Rotatable Bonds: 5
Polar Surface Area: 95.45Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.57CX Basic pKa: 1.96CX LogP: 5.98CX LogD: 5.95
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -1.49

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source