The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-2-((E)-((6-(4-bromophenyl)-2-ethylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylene)hydrazono)-3-(4-hydroxyphenyl)-5-methylthiazolidin-4-one ID: ALA4534243
PubChem CID: 155546725
Max Phase: Preclinical
Molecular Formula: C23H19BrN6O2S2
Molecular Weight: 555.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nn2c(/C=N/N=C3\SC(C)C(=O)N3c3ccc(O)cc3)c(-c3ccc(Br)cc3)nc2s1
Standard InChI: InChI=1S/C23H19BrN6O2S2/c1-3-19-28-30-18(20(26-22(30)34-19)14-4-6-15(24)7-5-14)12-25-27-23-29(21(32)13(2)33-23)16-8-10-17(31)11-9-16/h4-13,31H,3H2,1-2H3/b25-12+,27-23-
Standard InChI Key: KMVFDVLZZYCPJS-IVVNBYSSSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
7.9547 -25.0293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9363 -23.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4646 -24.3659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7286 -23.9335 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7378 -24.7604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5273 -25.0101 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.0077 -24.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5125 -23.6706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6425 -24.3784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2178 -23.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3917 -23.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9895 -24.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4152 -25.1130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2398 -25.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6704 -22.9060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8591 -22.7471 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5931 -21.9644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7817 -21.8054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4293 -21.0583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6083 -21.1565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4493 -21.9680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1720 -22.3685 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.0486 -20.5493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8244 -20.3420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6482 -20.3284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0464 -19.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6221 -18.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7953 -18.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4008 -19.6406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0196 -18.1831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7034 -22.3152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1669 -24.4124 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
10.8305 -24.3258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2497 -25.0337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 5 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 4 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
3 9 1 0
2 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 18 1 0
20 23 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
19 24 1 0
27 30 1 0
21 31 1 0
12 32 1 0
7 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 555.48Molecular Weight (Monoisotopic): 554.0194AlogP: 5.35#Rotatable Bonds: 5Polar Surface Area: 95.45Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.57CX Basic pKa: 1.96CX LogP: 5.98CX LogD: 5.95Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -1.49
References 1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R.. (2019) Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents., 174 [PMID:31051403 ] [10.1016/j.ejmech.2019.04.052 ]