The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(3-(3-acetamidophenyl)-1H-pyrazol-1-yl)-2-(3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl)ethyl)pyridine 1-oxide ID: ALA4534321
PubChem CID: 25120500
Max Phase: Preclinical
Molecular Formula: C29H28F2N4O4
Molecular Weight: 534.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1cccc(-c2ccn(C(Cc3cc[n+]([O-])cc3)c3ccc(OC(F)F)c(OCC4CC4)c3)n2)c1
Standard InChI: InChI=1S/C29H28F2N4O4/c1-19(36)32-24-4-2-3-22(16-24)25-11-14-35(33-25)26(15-20-9-12-34(37)13-10-20)23-7-8-27(39-29(30)31)28(17-23)38-18-21-5-6-21/h2-4,7-14,16-17,21,26,29H,5-6,15,18H2,1H3,(H,32,36)
Standard InChI Key: QEFVLMGONWRDJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
32.7399 -7.6436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7387 -8.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4468 -8.8721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1564 -8.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1536 -7.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4450 -7.2347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0321 -7.2352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0319 -6.4180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3241 -6.0095 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.7395 -6.0092 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.0307 -8.8712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0232 -9.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3117 -10.0886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4973 -10.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8994 -10.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8648 -8.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8661 -9.6873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5719 -8.4604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2802 -8.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2092 -10.1671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.4630 -10.9439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2802 -10.9426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5314 -10.1650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9839 -11.6043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1701 -11.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6910 -12.1798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0245 -12.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8418 -13.0088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3173 -12.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1780 -13.7536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7010 -14.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0372 -15.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8879 -14.3359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2769 -9.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9844 -10.0910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6924 -9.6812 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6885 -8.8598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9804 -8.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4013 -10.0877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
2 11 1 0
11 12 1 0
12 13 1 0
14 13 1 0
15 14 1 0
13 15 1 0
4 16 1 0
16 17 1 0
16 18 1 0
18 19 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 24 1 0
28 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
19 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 19 1 0
36 39 1 0
M CHG 2 36 1 39 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.56Molecular Weight (Monoisotopic): 534.2079AlogP: 5.36#Rotatable Bonds: 11Polar Surface Area: 92.32Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.99CX LogP: 4.38CX LogD: 4.38Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.21Np Likeness Score: -1.52
References 1. Jansen C, Kooistra AJ, Kanev GK, Leurs R, de Esch IJ, de Graaf C.. (2016) PDEStrIAn: A Phosphodiesterase Structure and Ligand Interaction Annotated Database As a Tool for Structure-Based Drug Design., 59 (15): [PMID:26908025 ] [10.1021/acs.jmedchem.5b01813 ]