The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-fluoro-N2,N3-bis(4-(trifluoromethoxy)phenyl)quinoxaline-2,3-diamine ID: ALA4534395
PubChem CID: 155546803
Max Phase: Preclinical
Molecular Formula: C22H13F7N4O2
Molecular Weight: 498.36
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccc2nc(Nc3ccc(OC(F)(F)F)cc3)c(Nc3ccc(OC(F)(F)F)cc3)nc2c1
Standard InChI: InChI=1S/C22H13F7N4O2/c23-12-1-10-17-18(11-12)33-20(31-14-4-8-16(9-5-14)35-22(27,28)29)19(32-17)30-13-2-6-15(7-3-13)34-21(24,25)26/h1-11H,(H,30,32)(H,31,33)
Standard InChI Key: ZWISIULSYYRDRW-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
20.3144 -15.0481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1717 -15.0492 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7420 -13.3887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6008 -13.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3126 -13.3951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7397 -15.0457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5996 -14.6352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1750 -13.3955 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.4596 -13.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0280 -13.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0268 -14.6327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4584 -14.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1770 -12.5783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8870 -12.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8894 -11.3604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1821 -10.9493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4711 -11.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4722 -12.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8930 -13.3994 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.1830 -10.1321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8911 -9.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8920 -8.9070 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.5984 -10.1336 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.5942 -9.3110 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.1694 -15.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4598 -16.2712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4572 -17.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1643 -17.4990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8755 -17.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8746 -16.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1631 -18.3162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.8702 -18.7259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8690 -19.5430 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.5785 -18.3183 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
24.5735 -19.1338 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9 8 1 0
6 12 2 0
12 9 1 0
10 11 1 0
12 2 1 0
10 5 2 0
7 1 1 0
5 4 1 0
1 11 2 0
11 6 1 0
9 3 2 0
4 7 2 0
10 3 1 0
8 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
4 19 1 0
16 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
21 24 1 0
2 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
28 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.36Molecular Weight (Monoisotopic): 498.0927AlogP: 7.05#Rotatable Bonds: 6Polar Surface Area: 68.30Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.71CX LogP: 8.37CX LogD: 8.37Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -1.04
References 1. (2017) Aryl amine substituted quinoxaline used as anticancer drugs,