3-(3-(1H-pyrazol-4-yl)-1H-indazol-6-yl)-4-methyl-N-(3-(trifluoromethyl)phenyl)benzamide

ID: ALA4534609

PubChem CID: 155546952

Max Phase: Preclinical

Molecular Formula: C25H18F3N5O

Molecular Weight: 461.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1-c1ccc2c(-c3cn[nH]c3)n[nH]c2c1

Standard InChI:  InChI=1S/C25H18F3N5O/c1-14-5-6-16(24(34)31-19-4-2-3-18(11-19)25(26,27)28)9-21(14)15-7-8-20-22(10-15)32-33-23(20)17-12-29-30-13-17/h2-13H,1H3,(H,29,30)(H,31,34)(H,32,33)

Standard InChI Key:  RYPDYJRZOCIUNT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   34.1319   -8.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8416   -8.4255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8387   -7.6028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1301   -7.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5419   -7.1929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2514   -7.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9571   -7.1899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9545   -6.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2402   -5.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5375   -6.3790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8271   -5.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6661   -7.5962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6688   -8.4134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3725   -7.1853    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.0815   -7.5916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0807   -8.4082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7889   -8.8144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4962   -8.4035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4909   -7.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7821   -7.1796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4239   -8.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4251   -7.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6489   -7.3559    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1679   -8.0158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6469   -8.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1983   -7.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8397   -6.7886    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   41.9986   -7.4628    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   41.3288   -6.3208    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   32.3970   -9.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6195   -9.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6183  -10.5242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3951  -10.7779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8763  -10.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 21  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 22  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3  5  1  0
 10 11  1  0
  7 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 21  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
 19 26  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 30  2  0
 25 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4534609

    ---

Associated Targets(Human)

KG-1 (867 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FGFR1 Tclin Fibroblast growth factor receptor 1 (9149 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DDR2 Tchem Discoidin domain-containing receptor 2 (2199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H2286 (27 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 461.45Molecular Weight (Monoisotopic): 461.1463AlogP: 6.20#Rotatable Bonds: 4
Polar Surface Area: 86.46Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.75CX Basic pKa: 2.08CX LogP: 5.76CX LogD: 5.76
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -1.67

References

1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B..  (2019)  Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma.,  163  [PMID:30572178] [10.1016/j.ejmech.2018.12.015]

Source