The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-(1H-pyrazol-4-yl)-1H-indazol-6-yl)-4-methyl-N-(3-(trifluoromethyl)phenyl)benzamide ID: ALA4534609
PubChem CID: 155546952
Max Phase: Preclinical
Molecular Formula: C25H18F3N5O
Molecular Weight: 461.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1-c1ccc2c(-c3cn[nH]c3)n[nH]c2c1
Standard InChI: InChI=1S/C25H18F3N5O/c1-14-5-6-16(24(34)31-19-4-2-3-18(11-19)25(26,27)28)9-21(14)15-7-8-20-22(10-15)32-33-23(20)17-12-29-30-13-17/h2-13H,1H3,(H,29,30)(H,31,34)(H,32,33)
Standard InChI Key: RYPDYJRZOCIUNT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
34.1319 -8.8349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8416 -8.4255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8387 -7.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1301 -7.1976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5419 -7.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2514 -7.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9571 -7.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9545 -6.3719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2402 -5.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5375 -6.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8271 -5.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6661 -7.5962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6688 -8.4134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3725 -7.1853 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.0815 -7.5916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0807 -8.4082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7889 -8.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4962 -8.4035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4909 -7.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7821 -7.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4239 -8.4260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4251 -7.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6489 -7.3559 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.1679 -8.0158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6469 -8.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1983 -7.1647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8397 -6.7886 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.9986 -7.4628 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.3288 -6.3208 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.3970 -9.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6195 -9.7070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6183 -10.5242 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3951 -10.7779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.8763 -10.1174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 22 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 5 1 0
10 11 1 0
7 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
26 27 1 0
26 28 1 0
26 29 1 0
19 26 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 30 2 0
25 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.45Molecular Weight (Monoisotopic): 461.1463AlogP: 6.20#Rotatable Bonds: 4Polar Surface Area: 86.46Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.75CX Basic pKa: 2.08CX LogP: 5.76CX LogD: 5.76Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -1.67
References 1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B.. (2019) Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma., 163 [PMID:30572178 ] [10.1016/j.ejmech.2018.12.015 ]