The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3-(1,4,7,10-Tetraazacyclododecan-1-yl)propoxy)-N-(3-chloro-4-fluorophenyl)-7-methoxyquinazolin-4-amine ID: ALA4534611
PubChem CID: 155546954
Max Phase: Preclinical
Molecular Formula: C26H35ClFN7O2
Molecular Weight: 532.06
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CCNCCNCCNCC1
Standard InChI: InChI=1S/C26H35ClFN7O2/c1-36-24-17-23-20(26(33-18-32-23)34-19-3-4-22(28)21(27)15-19)16-25(24)37-14-2-11-35-12-9-30-7-5-29-6-8-31-10-13-35/h3-4,15-18,29-31H,2,5-14H2,1H3,(H,32,33,34)
Standard InChI Key: GWENPWVERROOLI-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
4.1413 -5.4183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9309 -5.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9071 -4.3992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6226 -4.0234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4178 -3.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5991 -3.2587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2215 -2.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4244 -2.7453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4426 -3.5556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7301 -3.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9389 -4.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7607 -4.6858 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6057 -4.8140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3183 -4.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0210 -4.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7336 -4.4315 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4363 -4.8488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4222 -5.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1240 -6.0831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1426 -4.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8451 -4.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8346 -5.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5370 -6.0965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2502 -5.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2567 -4.8742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5538 -4.4615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7084 -6.0639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6961 -6.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5606 -3.6444 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2717 -3.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9731 -3.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6838 -3.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6911 -2.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9818 -2.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2741 -2.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4016 -2.0363 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.3878 -3.6728 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 1 1 0
3 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 22 2 0
21 20 2 0
20 17 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
32 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.06Molecular Weight (Monoisotopic): 531.2525AlogP: 3.03#Rotatable Bonds: 8Polar Surface Area: 95.60Molecular Species: BASEHBA: 9HBD: 4#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.06CX LogP: 2.70CX LogD: -1.66Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: -1.33
References 1. Ju Y, Wu J, Yuan X, Zhao L, Zhang G, Li C, Qiao R.. (2018) Design and Evaluation of Potent EGFR Inhibitors through the Incorporation of Macrocyclic Polyamine Moieties into the 4-Anilinoquinazoline Scaffold., 61 (24): [PMID:30508379 ] [10.1021/acs.jmedchem.8b01612 ]