6-(3-(1,4,7,10-Tetraazacyclododecan-1-yl)propoxy)-N-(3-chloro-4-fluorophenyl)-7-methoxyquinazolin-4-amine

ID: ALA4534611

PubChem CID: 155546954

Max Phase: Preclinical

Molecular Formula: C26H35ClFN7O2

Molecular Weight: 532.06

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCCN1CCNCCNCCNCC1

Standard InChI:  InChI=1S/C26H35ClFN7O2/c1-36-24-17-23-20(26(33-18-32-23)34-19-3-4-22(28)21(27)15-19)16-25(24)37-14-2-11-35-12-9-30-7-5-29-6-8-31-10-13-35/h3-4,15-18,29-31H,2,5-14H2,1H3,(H,32,33,34)

Standard InChI Key:  GWENPWVERROOLI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    4.1413   -5.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9309   -5.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9071   -4.3992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6226   -4.0234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4178   -3.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5991   -3.2587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2215   -2.5404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4244   -2.7453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4426   -3.5556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7301   -3.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9389   -4.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7607   -4.6858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6057   -4.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3183   -4.4142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0210   -4.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7336   -4.4315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4363   -4.8488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4222   -5.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1240   -6.0831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1426   -4.4483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8451   -4.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8346   -5.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5370   -6.0965    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2502   -5.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2567   -4.8742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5538   -4.4615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7084   -6.0639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6961   -6.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5606   -3.6444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2717   -3.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9731   -3.6599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6838   -3.2579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6911   -2.4399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9818   -2.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2741   -2.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4016   -2.0363    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.3878   -3.6728    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  1  1  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 22  2  0
 21 20  2  0
 20 17  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 18 27  1  0
 27 28  1  0
 26 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
 32 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4534611

    ---

Associated Targets(Human)

A-431 (6446 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EGFR Tclin Epidermal growth factor receptor erbB1 (33727 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ERBB2 Tclin Receptor protein-tyrosine kinase erbB-2 (7851 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 532.06Molecular Weight (Monoisotopic): 531.2525AlogP: 3.03#Rotatable Bonds: 8
Polar Surface Area: 95.60Molecular Species: BASEHBA: 9HBD: 4
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.06CX LogP: 2.70CX LogD: -1.66
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: -1.33

References

1. Ju Y, Wu J, Yuan X, Zhao L, Zhang G, Li C, Qiao R..  (2018)  Design and Evaluation of Potent EGFR Inhibitors through the Incorporation of Macrocyclic Polyamine Moieties into the 4-Anilinoquinazoline Scaffold.,  61  (24): [PMID:30508379] [10.1021/acs.jmedchem.8b01612]

Source