The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dehydroaustinol ID: ALA4534615
PubChem CID: 24871106
Max Phase: Preclinical
Molecular Formula: C25H28O8
Molecular Weight: 456.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C1[C@@]23C(=O)O[C@H](C)[C@]24O[C@@]2(C(=C)[C@]5(C=CC(=O)OC5(C)C)CC[C@]32C)[C@H](O)[C@@]1(C)OC4=O
Standard InChI: InChI=1S/C25H28O8/c1-12-21(7)16(27)24-13(2)22(9-8-15(26)31-19(22,4)5)11-10-20(24,6)23(12)17(28)30-14(3)25(23,33-24)18(29)32-21/h8-9,14,16,27H,1-2,10-11H2,3-7H3/t14-,16-,20-,21+,22+,23+,24+,25-/m1/s1
Standard InChI Key: IQBUQLYYAHHCGX-VRTAWDDNSA-N
Molfile:
RDKit 2D
33 38 0 0 0 0 0 0 0 0999 V2000
34.3043 -11.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5070 -11.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7212 -12.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5070 -10.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2207 -10.8657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9315 -10.4564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5040 -9.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0835 -10.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0835 -11.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7969 -11.6879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7969 -10.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2210 -9.2189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9327 -9.6314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6416 -9.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6453 -8.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9337 -7.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2184 -8.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3684 -11.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7881 -9.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5027 -7.9853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8654 -7.4803 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1221 -8.0066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6502 -7.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6794 -8.6658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3584 -7.4299 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0199 -9.9515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1135 -9.3879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8463 -9.9515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.5908 -10.6579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.9390 -9.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8051 -8.6283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2124 -10.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9262 -7.1589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 7 1 0
5 6 1 0
6 13 1 0
12 7 1 0
8 9 1 0
8 11 2 0
9 10 1 0
10 2 1 0
2 4 1 0
4 11 1 1
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
9 18 2 0
7 19 2 0
17 20 1 6
16 21 1 0
14 24 1 0
15 22 2 0
21 23 1 0
23 24 1 0
23 25 2 0
14 26 1 6
24 27 1 0
26 28 1 0
28 27 1 0
26 29 2 0
27 30 1 1
12 31 1 1
24 31 1 1
13 32 1 6
16 33 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.49Molecular Weight (Monoisotopic): 456.1784AlogP: 1.91#Rotatable Bonds: ┄Polar Surface Area: 108.36Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.74CX Basic pKa: ┄CX LogP: 2.08CX LogD: 2.08Aromatic Rings: ┄Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: 2.14
References 1. Bai M, Zheng CJ, Huang GL, Mei RQ, Wang B, Luo YP, Zheng C, Niu ZG, Chen GY.. (2019) Bioactive Meroterpenoids and Isocoumarins from the Mangrove-Derived Fungus Penicillium sp. TGM112., 82 (5): [PMID:30990038 ] [10.1021/acs.jnatprod.8b00866 ]