N-Cyclohexyl-2-[(3-phenethoxyphenyl)amino]benzamide

ID: ALA4534942

PubChem CID: 155548918

Max Phase: Preclinical

Molecular Formula: C27H30N2O2

Molecular Weight: 414.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NC1CCCCC1)c1ccccc1Nc1cccc(OCCc2ccccc2)c1

Standard InChI:  InChI=1S/C27H30N2O2/c30-27(29-22-12-5-2-6-13-22)25-16-7-8-17-26(25)28-23-14-9-15-24(20-23)31-19-18-21-10-3-1-4-11-21/h1,3-4,7-11,14-17,20,22,28H,2,5-6,12-13,18-19H2,(H,29,30)

Standard InChI Key:  KAJGHPYWROKPQT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   36.9868  -22.1673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9857  -22.9868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6937  -23.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4034  -22.9864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4005  -22.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6919  -21.7584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1117  -23.3939    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.1130  -24.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4046  -24.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4056  -25.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1144  -25.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8239  -25.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8194  -24.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1067  -21.7524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1036  -20.9353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.5336  -25.8348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.2392  -25.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9490  -25.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6546  -25.4154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3606  -25.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0657  -25.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0620  -24.5915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3473  -24.1867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6451  -24.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8159  -22.1584    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.5221  -21.7471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2300  -22.1557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9340  -21.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9352  -20.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2261  -20.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5158  -20.9318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  5 14  1  0
 14 15  2  0
 12 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 14 25  1  0
 25 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4534942

    ---

Associated Targets(Human)

SIRT1 Tchem NAD-dependent deacetylase sirtuin 1 (3505 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SIRT2 Tchem NAD-dependent deacetylase sirtuin 2 (3979 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.55Molecular Weight (Monoisotopic): 414.2307AlogP: 6.11#Rotatable Bonds: 8
Polar Surface Area: 50.36Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 7.44CX LogD: 7.44
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.11

References

1. Mellini P, Itoh Y, Elboray EE, Tsumoto H, Li Y, Suzuki M, Takahashi Y, Tojo T, Kurohara T, Miyake Y, Miura Y, Kitao Y, Kotoku M, Iida T, Suzuki T..  (2019)  Identification of Diketopiperazine-Containing 2-Anilinobenzamides as Potent Sirtuin 2 (SIRT2)-Selective Inhibitors Targeting the "Selectivity Pocket", Substrate-Binding Site, and NAD+-Binding Site.,  62  (12): [PMID:31144814] [10.1021/acs.jmedchem.9b00255]

Source