The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[(1S)-1-(1,6-Dimethylbenzimidazol-2-yl)-2-[1-(2-methylpropanoyl)-4-piperidyl]ethyl]-3-(4-phenoxyphenyl)imidazolidin-2-one ID: ALA4535018
PubChem CID: 155547555
Max Phase: Preclinical
Molecular Formula: C35H41N5O3
Molecular Weight: 579.75
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2nc([C@H](CC3CCN(C(=O)C(C)C)CC3)N3CCN(c4ccc(Oc5ccccc5)cc4)C3=O)n(C)c2c1
Standard InChI: InChI=1S/C35H41N5O3/c1-24(2)34(41)38-18-16-26(17-19-38)23-32(33-36-30-15-10-25(3)22-31(30)37(33)4)40-21-20-39(35(40)42)27-11-13-29(14-12-27)43-28-8-6-5-7-9-28/h5-15,22,24,26,32H,16-21,23H2,1-4H3/t32-/m0/s1
Standard InChI Key: KINNWMHNZPEFCD-YTTGMZPUSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
31.3531 -13.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3520 -14.1628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0642 -14.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7780 -14.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7751 -13.3356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0624 -12.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4854 -12.9243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1988 -13.3302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1985 -14.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9111 -14.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6182 -14.1438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6125 -13.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9035 -12.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3321 -14.5529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4219 -15.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2263 -15.5349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6354 -14.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0813 -14.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8464 -15.9190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.6321 -16.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4534 -16.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9381 -16.9087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.9429 -15.5783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7192 -15.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7138 -16.6516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4190 -17.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1301 -16.6584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1315 -15.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4257 -15.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9363 -14.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2168 -16.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6269 -17.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2087 -18.3650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6153 -19.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4370 -19.0834 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.8503 -18.3732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4462 -17.6599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8403 -19.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6616 -19.8043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4264 -20.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6051 -20.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8297 -21.2219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8439 -15.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
15 19 2 0
16 20 1 0
20 21 1 0
21 22 2 0
22 25 1 0
24 23 1 0
23 21 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
23 30 1 0
20 31 1 6
31 32 1 0
32 33 1 0
32 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
35 38 1 0
38 39 2 0
38 40 1 0
40 41 1 0
40 42 1 0
28 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 579.75Molecular Weight (Monoisotopic): 579.3209AlogP: 6.94#Rotatable Bonds: 8Polar Surface Area: 70.91Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.80CX LogP: 5.87CX LogD: 5.87Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.23Np Likeness Score: -1.13
References 1. Teno N, Yamashita Y, Masuda A, Iguchi Y, Oda K, Fujimori K, Hiramoto T, Nishimaki-Mogami T, Une M, Gohda K.. (2019) Identification of potent farnesoid X receptor (FXR) antagonist showing favorable PK profile and distribution toward target tissues: Comprehensive understanding of structure-activity relationship of FXR antagonists., 27 (11): [PMID:31029550 ] [10.1016/j.bmc.2019.04.029 ]