5-(3-Fluoropyridin-4-yl)-N-(4-morpholinophenyl)-4-phenoxy-7H-pyrrolo[2,3-d]pyrimidin-2-amine

ID: ALA4535060

PubChem CID: 155547912

Max Phase: Preclinical

Molecular Formula: C27H23FN6O2

Molecular Weight: 482.52

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Fc1cnccc1-c1c[nH]c2nc(Nc3ccc(N4CCOCC4)cc3)nc(Oc3ccccc3)c12

Standard InChI:  InChI=1S/C27H23FN6O2/c28-23-17-29-11-10-21(23)22-16-30-25-24(22)26(36-20-4-2-1-3-5-20)33-27(32-25)31-18-6-8-19(9-7-18)34-12-14-35-15-13-34/h1-11,16-17H,12-15H2,(H2,30,31,32,33)

Standard InChI Key:  GCGXRKFLQPCONE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   27.6593   -9.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6581  -10.4401    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3662  -10.8490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3644   -9.2117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0730   -9.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0778  -10.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8578  -10.6840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3352  -10.0189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8501   -9.3595    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.9515   -9.2121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2439   -9.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5362   -9.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8290   -9.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8288  -10.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5416  -10.8451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2458  -10.4347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1217  -10.8466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3672  -11.6662    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6600  -12.0757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4149  -10.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7100  -10.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7070  -11.6587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.4152  -12.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1264  -11.6605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9550  -11.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2483  -12.0763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2490  -12.8944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9622  -13.3019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6660  -12.8907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1136  -11.4551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5686  -12.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8250  -12.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6261  -13.0065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.1702  -12.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9109  -11.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4525  -11.0065    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
  3 18  1  0
 18 19  1  0
 17 20  1  0
 17 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 19 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 19  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
  7 30  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4535060

    ---

Associated Targets(Human)

ITK Tclin Tyrosine-protein kinase ITK/TSK (3699 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.52Molecular Weight (Monoisotopic): 482.1867AlogP: 5.53#Rotatable Bonds: 6
Polar Surface Area: 88.19Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.62CX Basic pKa: 4.61CX LogP: 5.19CX LogD: 5.19
Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -1.34

References

1. Tang G, Liu L, Wang X, Pan Z..  (2019)  Discovery of 7H-pyrrolo[2,3-d]pyrimidine derivatives as selective covalent irreversible inhibitors of interleukin-2-inducible T-cell kinase (Itk).,  173  [PMID:30999237] [10.1016/j.ejmech.2019.03.055]

Source