The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-(tert-butylamino)-1-(N-(4-((3,4-dichlorobenzyl)oxy)benzyl)formamido)-2-oxoethyl)-6-chloro-1H-indole-2-carboxylic acid ID: ALA4535119
PubChem CID: 155547556
Max Phase: Preclinical
Molecular Formula: C30H28Cl3N3O5
Molecular Weight: 616.93
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)NC(=O)C(c1c(C(=O)O)[nH]c2cc(Cl)ccc12)N(C=O)Cc1ccc(OCc2ccc(Cl)c(Cl)c2)cc1
Standard InChI: InChI=1S/C30H28Cl3N3O5/c1-30(2,3)35-28(38)27(25-21-10-7-19(31)13-24(21)34-26(25)29(39)40)36(16-37)14-17-4-8-20(9-5-17)41-15-18-6-11-22(32)23(33)12-18/h4-13,16,27,34H,14-15H2,1-3H3,(H,35,38)(H,39,40)
Standard InChI Key: HIWJCCRUFKOHBM-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
42.1093 -17.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1057 -18.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8191 -19.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8225 -17.4354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5366 -17.8467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5343 -18.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3196 -18.9308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
44.8072 -18.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3233 -17.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5804 -16.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3878 -16.6404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0301 -16.1951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.6450 -15.8565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
46.4524 -15.6872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7096 -14.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.0027 -16.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.2473 -15.4703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3896 -19.0830 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
44.2872 -15.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7369 -14.7965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.2227 -16.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6723 -15.7498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9326 -14.9679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3830 -14.3535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5747 -14.5226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3187 -15.3114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8699 -15.9223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0234 -13.9087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.2163 -14.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6651 -13.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9226 -12.6822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3723 -12.0687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5641 -12.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3093 -13.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8614 -13.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0618 -17.1074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.6323 -18.2658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0428 -18.9813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.0468 -17.5524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6287 -11.2846 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
38.0121 -11.6256 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 1 0
10 12 1 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
2 18 1 0
12 19 1 0
19 20 2 0
12 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
11 36 2 0
8 37 1 0
37 38 1 0
37 39 2 0
32 40 1 0
33 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.93Molecular Weight (Monoisotopic): 615.1095AlogP: 7.02#Rotatable Bonds: 10Polar Surface Area: 111.73Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.56CX Basic pKa: ┄CX LogP: 6.03CX LogD: 2.68Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.17Np Likeness Score: -1.03
References 1. Neochoritis CG, Atmaj J, Twarda-Clapa A, Surmiak E, Skalniak L, Köhler LM, Muszak D, Kurpiewska K, Kalinowska-Tłuścik J, Beck B, Holak TA, Dömling A.. (2019) Hitting on the move: Targeting intrinsically disordered protein states of the MDM2-p53 interaction., 182 [PMID:31421630 ] [10.1016/j.ejmech.2019.111588 ]