The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(3-acrylamidobenzamido)-2-methylphenyl)-4-(2,6-dichlorobenzamido)-1H-pyrazole-3-carboxamide 2,2,2-trifluoroacetate ID: ALA4535164
PubChem CID: 155547828
Max Phase: Preclinical
Molecular Formula: C30H23Cl2F3N6O6
Molecular Weight: 577.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(C(=O)Nc2ccc(NC(=O)c3n[nH]cc3NC(=O)c3c(Cl)cccc3Cl)c(C)c2)c1.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C28H22Cl2N6O4.C2HF3O2/c1-3-23(37)32-17-7-4-6-16(13-17)26(38)33-18-10-11-21(15(2)12-18)34-28(40)25-22(14-31-36-25)35-27(39)24-19(29)8-5-9-20(24)30;3-2(4,5)1(6)7/h3-14H,1H2,2H3,(H,31,36)(H,32,37)(H,33,38)(H,34,40)(H,35,39);(H,6,7)
Standard InChI Key: JMDFPPOMIAKKAZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
47 49 0 0 0 0 0 0 0 0999 V2000
8.5506 -6.1616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2583 -5.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8429 -5.7530 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.5506 -6.9788 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.8407 -6.5661 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.9660 -6.1616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2583 -4.9358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6621 -4.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4793 -4.5152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2535 -3.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2535 -5.2229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4372 -5.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0286 -5.9270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4373 -6.6357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2587 -6.6331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6635 -5.9256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0299 -4.5117 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.4807 -5.9222 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.1136 -4.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8878 -3.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7050 -3.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9555 -3.0296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2931 -2.5509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6333 -3.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9308 -4.5152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7050 -5.2229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3394 -3.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1555 -3.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5640 -3.1034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1554 -2.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3340 -2.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9291 -3.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5630 -1.6864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3802 -1.6853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7879 -0.9771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7898 -2.3925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3817 -3.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7905 -3.8051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6086 -3.8045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0161 -3.0913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6049 -2.3875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8333 -3.0873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2453 -3.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0625 -3.7890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8401 -4.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2522 -5.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5628 -4.5187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 1 0
1 5 1 0
2 6 1 0
2 7 2 0
8 9 1 0
8 10 2 0
8 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
12 17 1 0
16 18 1 0
9 20 1 0
21 19 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 20 2 0
19 25 1 0
19 26 2 0
25 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
40 42 1 0
42 43 1 0
43 44 2 0
43 45 1 0
45 46 2 0
28 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 577.43Molecular Weight (Monoisotopic): 576.1080AlogP: 5.91#Rotatable Bonds: 8Polar Surface Area: 145.08Molecular Species: NEUTRALHBA: 5HBD: 5#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.30CX Basic pKa: ┄CX LogP: 5.65CX LogD: 5.65Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: -1.53
References 1. Ferguson FM, Doctor ZM, Ficarro SB, Marto JA, Kim ND, Sim T, Gray NS.. (2019) Synthesis and structure activity relationships of a series of 4-amino-1H-pyrazoles as covalent inhibitors of CDK14., 29 (15): [PMID:31175010 ] [10.1016/j.bmcl.2019.05.024 ]