2-(3-chloro-4-fluorobenzyl)-6-(2-((tetrahydro-2H-pyran-4-yl)amino)pyrimidin-4-yl)isoindolin-1-one

ID: ALA4535176

PubChem CID: 146634734

Max Phase: Preclinical

Molecular Formula: C24H22ClFN4O2

Molecular Weight: 452.92

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1c2cc(-c3ccnc(NC4CCOCC4)n3)ccc2CN1Cc1ccc(F)c(Cl)c1

Standard InChI:  InChI=1S/C24H22ClFN4O2/c25-20-11-15(1-4-21(20)26)13-30-14-17-3-2-16(12-19(17)23(30)31)22-5-8-27-24(29-22)28-18-6-9-32-10-7-18/h1-5,8,11-12,18H,6-7,9-10,13-14H2,(H,27,28,29)

Standard InChI Key:  RXYKHFJWSKCMHB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   32.4015   -8.8198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4003   -9.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1084  -10.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1066   -8.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6957   -8.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6969   -7.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9899   -7.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2813   -7.5938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.2841   -8.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9917   -8.8198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.8152   -8.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8200   -9.6349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6000   -9.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0774   -9.2182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.5923   -8.5588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8402   -7.7801    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8945   -9.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2990   -8.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5780   -8.8264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5810   -9.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1161   -8.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5204   -7.7919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1076   -7.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2862   -7.0931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8855   -7.8030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3376   -7.7875    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   28.8708  -10.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8719  -10.8671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5794  -11.2769    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2873  -10.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2879  -10.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5111   -6.3750    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3 12  2  0
 11  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  1  5  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 15 16  2  0
 14 17  1  0
 17 18  1  0
  9 19  1  0
 19 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 18  1  0
 22 26  1  0
 20 27  1  0
 20 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 23 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4535176

    ---

Associated Targets(Human)

MAPK1 Tchem MAP kinase ERK2 (25055 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.92Molecular Weight (Monoisotopic): 452.1415AlogP: 4.68#Rotatable Bonds: 5
Polar Surface Area: 67.35Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.89CX Basic pKa: 3.84CX LogP: 3.72CX LogD: 3.72
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -1.31

References

1. Ji D, Zhang L, Zhu Q, Bai Y, Wu Y, Xu Y..  (2019)  Discovery of potent, orally bioavailable ERK1/2 inhibitors with isoindolin-1-one structure by structure-based drug design.,  164  [PMID:30605831] [10.1016/j.ejmech.2018.12.040]

Source