The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2alpha,3beta-(Isopropylidenedioxy)-olean-12-en-28-oic acid benzylamide ID: ALA4535228
PubChem CID: 155547707
Max Phase: Preclinical
Molecular Formula: C40H59NO3
Molecular Weight: 601.92
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)CC[C@]2(C(=O)NCc3ccccc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C[C@H]6OC(C)(C)O[C@@H]6C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1
Standard InChI: InChI=1S/C40H59NO3/c1-34(2)19-21-40(33(42)41-25-26-13-11-10-12-14-26)22-20-38(8)27(28(40)23-34)15-16-31-37(7)24-29-32(44-36(5,6)43-29)35(3,4)30(37)17-18-39(31,38)9/h10-15,28-32H,16-25H2,1-9H3,(H,41,42)/t28-,29+,30-,31+,32-,37-,38+,39+,40-/m0/s1
Standard InChI Key: MJSQUETXNWOAAE-PWHYYTDQSA-N
Molfile:
RDKit 2D
49 55 0 0 0 0 0 0 0 0999 V2000
4.6453 -20.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6453 -18.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3587 -19.0503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3598 -19.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0722 -20.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7922 -19.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0702 -18.6334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7871 -19.0507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7947 -17.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0710 -17.8090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5074 -17.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4972 -18.6403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1999 -19.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9171 -18.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2204 -17.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9243 -17.8363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6386 -17.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6592 -16.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9511 -16.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2307 -16.5930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3515 -18.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7794 -18.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6351 -18.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5014 -16.9978 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.4893 -19.4640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0654 -19.4600 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.3556 -20.7012 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.2239 -21.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0514 -21.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6350 -19.0746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3551 -17.8334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5318 -15.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3593 -15.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0709 -18.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7866 -17.8334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5012 -18.2515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2165 -17.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2170 -17.0101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4962 -16.5965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7838 -17.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9318 -19.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9274 -19.0458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1335 -18.7924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6503 -19.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1408 -20.1397 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9274 -18.2192 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.9318 -20.7044 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.9335 -19.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9335 -19.8767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42 2 1 0
41 1 1 0
1 4 1 0
3 2 1 0
3 4 1 0
3 7 1 0
4 5 1 0
5 6 1 0
6 8 1 0
7 8 1 0
7 10 1 0
8 12 1 0
11 9 2 0
9 10 1 0
11 12 1 0
11 15 1 0
12 13 1 0
13 14 1 0
14 16 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
3 21 1 1
8 22 1 1
16 23 1 1
15 24 1 1
12 25 1 6
7 26 1 6
4 27 1 6
1 28 1 0
1 29 1 0
23 30 2 0
23 31 1 0
19 32 1 0
19 33 1 0
31 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
41 45 1 0
42 46 1 1
41 47 1 6
44 48 1 0
44 49 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 601.92Molecular Weight (Monoisotopic): 601.4495AlogP: 9.23#Rotatable Bonds: 3Polar Surface Area: 47.56Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 0.40CX LogP: 8.36CX LogD: 8.36Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.35Np Likeness Score: 2.07
References 1. Sommerwerk S, Heller L, Kuhfs J, Csuk R.. (2016) Urea derivates of ursolic, oleanolic and maslinic acid induce apoptosis and are selective cytotoxic for several human tumor cell lines., 119 [PMID:27149037 ] [10.1016/j.ejmech.2016.04.051 ]