2-(3-(3-Chlorophenyl)-9H-carbazol-9-yl)-N-(3-methoxybenzyl)-N-methylacetamide

ID: ALA4535242

PubChem CID: 155547768

Max Phase: Preclinical

Molecular Formula: C29H25ClN2O2

Molecular Weight: 468.98

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(CN(C)C(=O)Cn2c3ccccc3c3cc(-c4cccc(Cl)c4)ccc32)c1

Standard InChI:  InChI=1S/C29H25ClN2O2/c1-31(18-20-7-5-10-24(15-20)34-2)29(33)19-32-27-12-4-3-11-25(27)26-17-22(13-14-28(26)32)21-8-6-9-23(30)16-21/h3-17H,18-19H2,1-2H3

Standard InChI Key:  UOVOFLCXPYUNBF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   16.9835  -13.3227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5749  -14.5815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3251  -13.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5300  -13.6356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9840  -14.2403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2385  -15.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0330  -15.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6465  -13.8048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3903  -14.5790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9322  -15.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7303  -15.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9837  -14.2415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4401  -13.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9818  -12.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6886  -12.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6868  -11.2782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3972  -12.5025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3937  -10.8681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9783  -10.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1023  -11.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0998  -12.0897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8076  -12.4967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5154  -12.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5110  -11.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8027  -10.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2164  -10.8526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9264  -11.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2738  -15.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0177  -16.4021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5623  -17.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3630  -16.8427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6162  -16.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0700  -15.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4154  -15.8905    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  8  1  1  0
  1  3  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 24 26  1  0
 26 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 11 28  1  0
 32 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4535242

    ---

Associated Targets(Human)

TSPO Tchem Translocator protein (484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 468.98Molecular Weight (Monoisotopic): 468.1605AlogP: 6.78#Rotatable Bonds: 6
Polar Surface Area: 34.47Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.25CX LogD: 6.25
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.27Np Likeness Score: -1.35

References

1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M..  (2019)  First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold.,  62  (17): [PMID:31419132] [10.1021/acs.jmedchem.9b00980]

Source