The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(3-(1-ethyl-1H-pyrazol-4-yl)-1H-indazol-6-yl)-4-methyl-N-(3-(trifluoromethyl)phenyl)benzamide ID: ALA4535267
PubChem CID: 155547874
Max Phase: Preclinical
Molecular Formula: C27H22F3N5O
Molecular Weight: 489.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCn1cc(-c2n[nH]c3cc(-c4cc(C(=O)Nc5cccc(C(F)(F)F)c5)ccc4C)ccc23)cn1
Standard InChI: InChI=1S/C27H22F3N5O/c1-3-35-15-19(14-31-35)25-22-10-9-17(12-24(22)33-34-25)23-11-18(8-7-16(23)2)26(36)32-21-6-4-5-20(13-21)27(28,29)30/h4-15H,3H2,1-2H3,(H,32,36)(H,33,34)
Standard InChI Key: FQZREJPMQAXXHX-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
34.1814 -20.4159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8911 -20.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8883 -19.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1796 -18.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5914 -18.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3009 -19.1815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0066 -18.7709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0040 -17.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2898 -17.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5870 -17.9600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8766 -17.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7157 -19.1772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7183 -19.9944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.4220 -18.7663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.1311 -19.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1302 -19.9892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8384 -20.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5457 -19.9845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5404 -19.1631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8316 -18.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4734 -20.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4746 -19.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6984 -18.9369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.2174 -19.5968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6964 -20.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.2478 -18.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8892 -18.3696 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.0481 -19.0438 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
41.3784 -17.9018 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.4465 -21.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6690 -21.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6678 -22.1052 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4447 -22.3589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.9259 -21.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6961 -23.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1485 -23.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 22 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
3 5 1 0
10 11 1 0
7 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 21 1 0
26 27 1 0
26 28 1 0
26 29 1 0
19 26 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 30 2 0
25 30 1 0
33 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 489.50Molecular Weight (Monoisotopic): 489.1776AlogP: 6.69#Rotatable Bonds: 5Polar Surface Area: 75.60Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.32CX Basic pKa: 1.70CX LogP: 6.24CX LogD: 6.24Aromatic Rings: 5Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.82
References 1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B.. (2019) Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma., 163 [PMID:30572178 ] [10.1016/j.ejmech.2018.12.015 ]