The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4535269
PubChem CID: 102004319
Max Phase: Preclinical
Molecular Formula: C23H33NO7
Molecular Weight: 435.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)[C@]23[C@H](OC(=O)[C@H](C)N)[C@H]1CC[C@H]2[C@@]12CO[C@]3(O)[C@@H](O)[C@@H]1C(C)(C)CC[C@@H]2O
Standard InChI: InChI=1S/C23H33NO7/c1-10-12-5-6-13-21-9-30-23(29,17(27)15(21)20(3,4)8-7-14(21)25)22(13,16(10)26)18(12)31-19(28)11(2)24/h11-15,17-18,25,27,29H,1,5-9,24H2,2-4H3/t11-,12-,13-,14-,15+,17-,18+,21+,22-,23+/m0/s1
Standard InChI Key: MUPGXJSKKAMOPF-PUJMDJIGSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
44.2978 -15.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0127 -14.6763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5829 -14.6763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2978 -15.9146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3390 -16.5776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9305 -15.8646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5173 -16.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2216 -14.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2216 -15.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9341 -14.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6467 -14.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6431 -15.4560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3524 -15.8695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0696 -15.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3594 -14.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0692 -14.6390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7845 -14.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7961 -13.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0862 -12.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3647 -13.3956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9341 -13.3880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3477 -16.6950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.7833 -15.8771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.3523 -15.0474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6393 -13.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7782 -14.9932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4786 -13.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2750 -13.4881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3619 -15.5769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.7685 -13.6298 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
39.9221 -15.0391 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
45.7277 -15.0891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.0127 -13.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.7961 -12.5873 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
6 5 1 0
7 6 1 0
8 9 1 0
8 10 1 0
9 6 1 0
6 12 1 0
11 10 1 0
11 12 1 0
11 15 1 0
12 13 1 0
13 14 1 0
14 16 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
10 21 1 6
13 22 1 1
14 23 1 0
14 24 1 6
11 25 1 6
25 24 1 0
16 26 1 1
18 27 1 0
26 27 1 0
17 3 1 1
27 28 2 0
26 29 2 0
15 30 1 1
12 31 1 1
2 32 1 0
2 33 1 6
18 34 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.52Molecular Weight (Monoisotopic): 435.2257AlogP: 0.27#Rotatable Bonds: 2Polar Surface Area: 139.31Molecular Species: NEUTRALHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.51CX Basic pKa: 7.14CX LogP: 0.63CX LogD: 0.44Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: 3.47
References 1. Hu X, Bai Z, Qiao J, Li H, Xu S, Wang X, Xu Y, Xu J, Hua H, Li D.. (2019) Effective enmein-type mimics of clinical candidate HAO472: Design, synthesis and biological evaluation., 171 [PMID:30921757 ] [10.1016/j.ejmech.2019.03.046 ]