The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,6-dichloro-N-(4-(6,7-dimethoxyquinolin-4-yloxy)-2-fluorophenyl)benzenesulfonamide ID: ALA4535274
PubChem CID: 44253474
Max Phase: Preclinical
Molecular Formula: C23H17Cl2FN2O5S
Molecular Weight: 523.37
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2nccc(Oc3ccc(NS(=O)(=O)c4c(Cl)cccc4Cl)c(F)c3)c2cc1OC
Standard InChI: InChI=1S/C23H17Cl2FN2O5S/c1-31-21-11-14-19(12-22(21)32-2)27-9-8-20(14)33-13-6-7-18(17(26)10-13)28-34(29,30)23-15(24)4-3-5-16(23)25/h3-12,28H,1-2H3
Standard InChI Key: HYLPAUGDDLRNBK-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
8.7291 -28.5645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3246 -27.8588 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.9157 -28.5620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6854 -30.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6843 -31.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3923 -31.5636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3905 -29.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9762 -31.5627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9776 -29.9267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2688 -31.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2700 -30.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0991 -30.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0999 -31.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8084 -31.5576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -31.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5120 -30.3246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8029 -29.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7985 -29.1041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5041 -28.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2093 -29.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9144 -28.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9105 -27.8702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1957 -27.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4935 -27.8796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1884 -26.6484 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6155 -27.4570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0309 -27.4476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7381 -27.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4439 -27.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4413 -26.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7271 -26.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0243 -26.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3134 -26.2315 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.7393 -28.6734 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 13 2 0
12 7 2 0
7 4 1 0
5 8 1 0
4 9 1 0
8 10 1 0
9 11 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
23 25 1 0
22 26 1 0
26 2 1 0
2 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
32 33 1 0
28 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 523.37Molecular Weight (Monoisotopic): 522.0219AlogP: 6.29#Rotatable Bonds: 7Polar Surface Area: 86.75Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.67CX Basic pKa: 5.89CX LogP: 5.05CX LogD: 4.98Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -1.29
References 1. Szabadkai I, Torka R, Garamvölgyi R, Baska F, Gyulavári P, Boros S, Illyés E, Choidas A, Ullrich A, Őrfi L.. (2018) Discovery of N-[4-(Quinolin-4-yloxy)phenyl]benzenesulfonamides as Novel AXL Kinase Inhibitors., 61 (14): [PMID:29928803 ] [10.1021/acs.jmedchem.8b00672 ]