The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-Hydroxy-1-((4-(4-nitrobenzamido)phenyl)sulfonyl)pyrrolidine-2-carboxamide ID: ALA4535400
PubChem CID: 155547834
Max Phase: Preclinical
Molecular Formula: C19H19N3O7S
Molecular Weight: 433.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(S(=O)(=O)C2CCC[C@@H]2C(=O)NO)cc1)c1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C19H19N3O7S/c23-18(12-4-8-14(9-5-12)22(26)27)20-13-6-10-15(11-7-13)30(28,29)17-3-1-2-16(17)19(24)21-25/h4-11,16-17,25H,1-3H2,(H,20,23)(H,21,24)/t16-,17?/m0/s1
Standard InChI Key: OIQMFKLUPFKRJF-BHWOMJMDSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
16.0467 -17.4087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3409 -17.8214 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.0512 -18.2262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0449 -17.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8621 -17.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1165 -16.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4535 -15.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7948 -16.3843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8974 -16.1310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5039 -16.6786 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0684 -15.3319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8460 -15.0804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0084 -18.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1946 -18.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8613 -19.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3410 -20.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1578 -19.9693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4873 -19.2238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0088 -20.8034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1961 -20.8890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8638 -21.6356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7156 -20.2279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0505 -21.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7182 -22.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1988 -23.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0154 -23.0384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3440 -22.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8668 -23.8769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3481 -24.5373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0542 -23.9636 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 4 1 0
9 10 2 0
9 11 1 0
6 9 1 6
11 12 1 0
5 2 1 0
2 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
28 29 2 0
28 30 1 0
25 28 1 0
M CHG 2 28 1 30 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 433.44Molecular Weight (Monoisotopic): 433.0944AlogP: 2.29#Rotatable Bonds: 6Polar Surface Area: 155.71Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.86CX Basic pKa: ┄CX LogP: 2.07CX LogD: 2.06Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.36Np Likeness Score: -1.16
References 1. Lenci E, Innocenti R, Di Francescantonio T, Menchi G, Bianchini F, Contini A, Trabocchi A.. (2019) Identification of highly potent and selective MMP2 inhibitors addressing the S1' subsite with d-proline-based compounds., 27 (9): [PMID:30926311 ] [10.1016/j.bmc.2019.03.043 ]