The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[6-(2-Ethyl-5-fluoro-4-hydroxy-phenyl)-1H-indazol-4-yl]-2-(4-methylpiperazin-1-yl)-ethanesulfonamide ID: ALA4535413
PubChem CID: 155547921
Max Phase: Preclinical
Molecular Formula: C22H28FN5O3S
Molecular Weight: 461.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(O)c(F)cc1-c1cc(NS(=O)(=O)CCN2CCN(C)CC2)c2cn[nH]c2c1
Standard InChI: InChI=1S/C22H28FN5O3S/c1-3-15-12-22(29)19(23)13-17(15)16-10-20-18(14-24-25-20)21(11-16)26-32(30,31)9-8-28-6-4-27(2)5-7-28/h10-14,26,29H,3-9H2,1-2H3,(H,24,25)
Standard InChI Key: NZYORBJRMHZJSJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
33.7112 -11.4118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5007 -12.2042 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.2922 -11.9903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.7947 -10.9811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5043 -10.5717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5015 -9.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7929 -9.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2046 -9.3390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9142 -9.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6199 -9.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6172 -8.5180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9030 -8.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2003 -8.5252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0866 -10.5721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0879 -9.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3074 -9.4961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8237 -10.1597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3054 -10.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7945 -11.7983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3228 -8.1058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.5019 -13.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9164 -10.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8970 -7.2951 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
35.6252 -10.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7948 -13.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7959 -14.2511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0901 -14.6564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0894 -15.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7958 -15.8814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.5048 -15.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5072 -14.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7939 -16.6986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
14 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 15 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 8 2 0
6 8 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 2 0
18 14 1 0
4 19 1 0
19 2 1 0
11 20 1 0
2 21 1 0
9 22 1 0
12 23 1 0
22 24 1 0
21 25 1 0
25 26 1 0
26 27 1 0
26 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.56Molecular Weight (Monoisotopic): 461.1897AlogP: 2.63#Rotatable Bonds: 7Polar Surface Area: 101.56Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.53CX Basic pKa: 6.93CX LogP: 1.59CX LogD: 1.62Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.39
References 1. Ritzén A, Sørensen MD, Dack KN, Greve DR, Jerre A, Carnerup MA, Rytved KA, Bagger-Bahnsen J.. (2016) Fragment-Based Discovery of 6-Arylindazole JAK Inhibitors., 7 (6): [PMID:27326341 ] [10.1021/acsmedchemlett.6b00087 ]