The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Betahydroxy dihydro costunolide acetate ID: ALA4535452
PubChem CID: 155547566
Max Phase: Preclinical
Molecular Formula: C17H24O4
Molecular Weight: 292.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@H]1C/C=C(\C)CC[C@H]2[C@H](C)C(=O)O[C@@H]2/C=C/1C
Standard InChI: InChI=1S/C17H24O4/c1-10-5-7-14-12(3)17(19)21-16(14)9-11(2)15(8-6-10)20-13(4)18/h6,9,12,14-16H,5,7-8H2,1-4H3/b10-6+,11-9+/t12-,14-,15-,16+/m0/s1
Standard InChI Key: GYXQQENGZKKHNQ-IWACHJLPSA-N
Molfile:
RDKit 2D
23 24 0 0 0 0 0 0 0 0999 V2000
14.6011 -2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6011 -3.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3074 -3.9271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3074 -2.2864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0138 -2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0126 -3.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4329 -2.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7246 -2.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5922 -3.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3087 -4.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4318 -3.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7190 -3.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8823 -4.7351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7001 -4.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0371 -4.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1028 -5.5363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0101 -2.9467 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.1365 -4.5095 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.8374 -3.9133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8935 -3.9290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1856 -3.5207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4781 -3.9296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1853 -2.7035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 2 0
5 4 2 0
5 8 1 0
6 12 1 0
11 7 1 0
7 8 1 0
5 9 1 0
3 10 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
11 15 1 0
14 16 2 0
11 17 1 6
12 18 1 1
15 19 1 6
2 20 1 1
20 21 1 0
21 22 1 0
21 23 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 292.38Molecular Weight (Monoisotopic): 292.1675AlogP: 3.17#Rotatable Bonds: 1Polar Surface Area: 52.60Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.88CX LogD: 2.88Aromatic Rings: ┄Heavy Atoms: 21QED Weighted: 0.55Np Likeness Score: 3.14
References 1. (2014) Methods of identifying antagonists of the hTAS2R46 bitter taste receptor,