The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-hydroxy-3-(4-(((3-(4-methoxyphenyl)ureido)oxy)methyl)phenyl)acrylamide ID: ALA4535463
PubChem CID: 155547606
Max Phase: Preclinical
Molecular Formula: C18H19N3O5
Molecular Weight: 357.37
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC(=O)NOCc2ccc(/C=C/C(=O)NO)cc2)cc1
Standard InChI: InChI=1S/C18H19N3O5/c1-25-16-9-7-15(8-10-16)19-18(23)21-26-12-14-4-2-13(3-5-14)6-11-17(22)20-24/h2-11,24H,12H2,1H3,(H,20,22)(H2,19,21,23)/b11-6+
Standard InChI Key: LZFRGGLRIPWNJS-IZZDOVSWSA-N
Molfile:
RDKit 2D
26 27 0 0 0 0 0 0 0 0999 V2000
22.3929 -2.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3918 -3.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0998 -4.1794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8095 -3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8067 -2.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0980 -2.5421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6837 -4.1785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9764 -3.7693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5128 -2.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2221 -2.9420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9282 -2.5307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6375 -2.9367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9251 -1.7136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.3436 -2.5254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.2683 -4.1774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5609 -3.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8529 -4.1763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5616 -2.9510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1455 -3.7671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1512 -2.9519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4446 -2.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7356 -2.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7376 -3.7724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4447 -4.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0277 -2.5427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3202 -2.9517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
5 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
8 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 357.37Molecular Weight (Monoisotopic): 357.1325AlogP: 2.47#Rotatable Bonds: 7Polar Surface Area: 108.92Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.73CX Basic pKa: ┄CX LogP: 2.17CX LogD: 2.15Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.35Np Likeness Score: -0.69
References 1. Pflieger M, Hamacher A, Öz T, Horstick-Muche N, Boesen B, Schrenk C, Kassack MU, Kurz T.. (2019) Novel α,β-unsaturated hydroxamic acid derivatives overcome cisplatin resistance., 27 (19): [PMID:31431326 ] [10.1016/j.bmc.2019.07.052 ]