1-(4,5-Bis(4-(tert-butyl)phenyl)thiazol-2-yl)-N-(piperidin-4-ylmethyl)methanamine

ID: ALA4535532

PubChem CID: 155547999

Max Phase: Preclinical

Molecular Formula: C30H41N3S

Molecular Weight: 475.75

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)c1ccc(-c2nc(CNCC3CCNCC3)sc2-c2ccc(C(C)(C)C)cc2)cc1

Standard InChI:  InChI=1S/C30H41N3S/c1-29(2,3)24-11-7-22(8-12-24)27-28(23-9-13-25(14-10-23)30(4,5)6)34-26(33-27)20-32-19-21-15-17-31-18-16-21/h7-14,21,31-32H,15-20H2,1-6H3

Standard InChI Key:  AEAIJIUTWWOCDU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   19.6617   -4.3253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8404   -4.3253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5879   -5.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2490   -5.5912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.9142   -5.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6955   -5.3591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3069   -4.8123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0883   -5.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3579   -3.6646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6961   -2.9134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2124   -2.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3946   -2.3378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0629   -3.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5445   -3.7509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8101   -5.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1988   -4.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4180   -5.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2475   -5.8658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8638   -6.4176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6421   -6.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9129   -1.6776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2438   -0.9304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1004   -1.7647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4965   -0.9658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4707   -6.1196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8625   -5.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3021   -6.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6764   -6.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6947   -4.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4723   -4.7684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5235   -3.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1300   -3.1703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9076   -3.4216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0787   -4.2206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  1  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2  9  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  3 15  1  0
 12 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
 18 25  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
  8 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 30 34  1  0
 32 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4535532

    ---

Associated Targets(Human)

EP300 Tchem Histone acetyltransferase p300 (1259 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.75Molecular Weight (Monoisotopic): 475.3021AlogP: 7.16#Rotatable Bonds: 6
Polar Surface Area: 36.95Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.37CX LogP: 7.14CX LogD: 2.84
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -0.81

References

1. Wu F, Hua Y, Kaochar S, Nie S, Lin YL, Yao Y, Wu J, Wu X, Fu X, Schiff R, Davis CM, Robertson M, Ehli EA, Coarfa C, Mitsiades N, Song Y..  (2020)  Discovery, Structure-Activity Relationship, and Biological Activity of Histone-Competitive Inhibitors of Histone Acetyltransferases P300/CBP.,  63  (9): [PMID:32314924] [10.1021/acs.jmedchem.9b02164]

Source