The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((Trans-4-(3-(diamantan-3-yl)ureido)cyclohexyl)oxy)benzoic acid ID: ALA4535555
PubChem CID: 155547570
Max Phase: Preclinical
Molecular Formula: C28H36N2O4
Molecular Weight: 464.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC1C2CC3C4CC5CC3C1C(C5)C4C2)N[C@H]1CC[C@H](Oc2ccc(C(=O)O)cc2)CC1
Standard InChI: InChI=1S/C28H36N2O4/c31-27(32)15-1-5-18(6-2-15)34-19-7-3-17(4-8-19)29-28(33)30-26-16-12-21-20-9-14-10-23(21)25(26)24(11-14)22(20)13-16/h1-2,5-6,14,16-17,19-26H,3-4,7-13H2,(H,31,32)(H2,29,30,33)/t14?,16?,17-,19-,20?,21?,22?,23?,24?,25?,26?
Standard InChI Key: JTHDOQBQEZCDCT-TZYVQZSTSA-N
Molfile:
RDKit 2D
34 40 0 0 0 0 0 0 0 0999 V2000
21.9467 -8.4571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5819 -7.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7394 -8.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2824 -8.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4891 -8.5341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0232 -7.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7368 -7.3939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2881 -6.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5775 -6.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0331 -7.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4485 -7.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1562 -6.6366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7408 -6.6366 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.4485 -7.8624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.8639 -7.0452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9403 -9.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4839 -9.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6461 -9.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2858 -8.9313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8577 -7.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5613 -8.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2714 -7.8622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2734 -7.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5652 -6.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9776 -8.2735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6868 -7.8675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3918 -8.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1006 -7.8757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1041 -7.0576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3930 -6.6465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6871 -7.0541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8142 -6.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5209 -7.0585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.8162 -5.8310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
2 4 1 0
3 5 1 0
4 6 1 0
5 6 1 0
7 8 1 0
3 7 1 0
2 9 1 0
6 10 1 0
10 8 1 0
8 9 1 0
11 12 1 0
11 13 1 0
11 14 2 0
15 12 1 6
13 10 1 0
1 16 1 0
5 17 1 0
16 18 1 0
18 17 1 0
4 19 1 0
19 18 1 0
15 20 1 0
15 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 1 1
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
32 33 1 0
32 34 2 0
29 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.61Molecular Weight (Monoisotopic): 464.2675AlogP: 4.69#Rotatable Bonds: 5Polar Surface Area: 87.66Molecular Species: ACIDHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.36CX Basic pKa: 0.43CX LogP: 3.88CX LogD: 0.96Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.59Np Likeness Score: 0.05
References 1. Codony S, Valverde E, Leiva R, Brea J, Isabel Loza M, Morisseau C, Hammock BD, Vázquez S.. (2019) Exploring the size of the lipophilic unit of the soluble epoxide hydrolase inhibitors., 27 (20): [PMID:31488357 ] [10.1016/j.bmc.2019.115078 ]