3-methoxy-4-(5-(4-(5-(4-nitrophenyl)-1,3,4-thiadiazol-2-yl)phenyl)-1,3,4-oxadiazol-2-yl)phenol

ID: ALA4535617

PubChem CID: 155547952

Max Phase: Preclinical

Molecular Formula: C23H15N5O5S

Molecular Weight: 473.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)ccc1-c1nnc(-c2ccc(-c3nnc(-c4ccc([N+](=O)[O-])cc4)s3)cc2)o1

Standard InChI:  InChI=1S/C23H15N5O5S/c1-32-19-12-17(29)10-11-18(19)21-25-24-20(33-21)13-2-4-14(5-3-13)22-26-27-23(34-22)15-6-8-16(9-7-15)28(30)31/h2-12,29H,1H3

Standard InChI Key:  SLXJUJCMXZQKCH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    2.9826  -23.1537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9814  -23.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6895  -24.3822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3991  -23.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3963  -23.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6877  -22.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2734  -24.3813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6852  -21.9277    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9763  -21.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1002  -22.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8480  -23.0701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3925  -22.4607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9813  -21.7545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1248  -21.9275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3077  -21.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1213  -20.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4509  -20.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9678  -19.5141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1515  -19.6057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8257  -20.3529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2927  -18.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0911  -18.5934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1723  -17.7802    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4240  -17.4517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8805  -18.0330    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.2595  -16.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8716  -16.1110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7076  -15.3112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9315  -15.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3190  -15.6001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4861  -16.3979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7648  -14.2508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9890  -13.9940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3751  -13.7073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  6  8  1  0
  8  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  1  0
  5 10  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  1  0
 18 21  1  0
 24 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 32 33  2  0
 32 34  1  0
 29 32  1  0
M  CHG  2  32   1  34  -1
M  END

Alternative Forms

  1. Parent:

    ALA4535617

    ---

Associated Targets(Human)

GUSB Tchem Beta-glucuronidase (537 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.47Molecular Weight (Monoisotopic): 473.0794AlogP: 5.21#Rotatable Bonds: 6
Polar Surface Area: 137.30Molecular Species: NEUTRALHBA: 10HBD: 1
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.53CX Basic pKa: CX LogP: 4.31CX LogD: 4.28
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.78

References

1. Taha M, Imran S, Alomari M, Rahim F, Wadood A, Mosaddik A, Uddin N, Gollapalli M, Alqahtani MA, Bamarouf YA..  (2019)  Synthesis of oxadiazole-coupled-thiadiazole derivatives as a potent β-glucuronidase inhibitors and their molecular docking study.,  27  (14): [PMID:31196753] [10.1016/j.bmc.2019.05.049]

Source