The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Alisol B 23-acetate ID: ALA4535717
Cas Number: 26575-95-1
PubChem CID: 14036811
Product Number: A422938, Order Now?
Max Phase: Preclinical
Molecular Formula: C32H50O5
Molecular Weight: 514.75
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@@H](C[C@@H](C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1)[C@H]1OC1(C)C
Standard InChI: InChI=1S/C32H50O5/c1-18(16-23(36-19(2)33)27-29(5,6)37-27)20-10-14-31(8)21(20)17-22(34)26-30(7)13-12-25(35)28(3,4)24(30)11-15-32(26,31)9/h18,22-24,26-27,34H,10-17H2,1-9H3/t18-,22+,23+,24+,26+,27-,30+,31+,32+/m1/s1
Standard InChI Key: NLOAQXKIIGTTRE-JSWHPQHOSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
26.9384 -29.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5340 -29.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1209 -29.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8282 -27.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8282 -28.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5376 -27.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2429 -27.8753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2394 -28.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9456 -29.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6597 -28.7026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9525 -27.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6594 -27.8838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6761 -26.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9578 -26.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3829 -26.6654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3696 -27.4832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1435 -27.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9455 -28.2880 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.2356 -27.0540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6512 -27.0622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2315 -29.5138 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.1170 -29.1104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.3652 -28.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1651 -26.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6354 -27.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4295 -25.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2313 -25.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7688 -26.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5044 -26.8846 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.8920 -25.0379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2538 -26.2339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.0418 -27.5002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7775 -28.2734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8437 -27.3425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6324 -25.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8312 -25.1759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5734 -25.9489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3717 -25.7857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2889 -24.5646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7826 -26.7362 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 6 1 0
5 2 1 0
2 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 14 1 0
12 16 1 0
15 13 1 0
13 14 1 0
15 16 1 0
16 17 1 0
17 25 1 0
24 15 2 0
11 18 1 1
7 19 1 1
12 20 1 6
8 21 1 6
5 22 2 0
16 23 1 1
24 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
28 37 1 0
28 29 1 1
26 30 1 6
14 31 1 1
29 32 1 0
32 33 1 0
32 34 2 0
36 35 1 0
37 36 1 0
38 37 1 0
36 38 1 0
36 39 1 0
37 40 1 1
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.75Molecular Weight (Monoisotopic): 514.3658AlogP: 6.41#Rotatable Bonds: 5Polar Surface Area: 76.13Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.35CX LogD: 5.35Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.26Np Likeness Score: 3.29
References 1. Luan ZL, Huo XK, Dong PP, Tian XG, Sun CP, Lv X, Feng L, Ning J, Wang C, Zhang BJ, Ma XC.. (2019) Highly potent non-steroidal FXR agonists protostane-type triterpenoids: Structure-activity relationship and mechanism., 182 [PMID:31494470 ] [10.1016/j.ejmech.2019.111652 ]