The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-Hydroxycyclopentyl)thio-3-isopropyl-7-[4-(2-pyridyl)-benzyl]amino-1H-pyrazolo[4,3-d]pyrimidine ID: ALA4535735
PubChem CID: 155547680
Max Phase: Preclinical
Molecular Formula: C25H28N6OS
Molecular Weight: 460.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1n[nH]c2c(NCc3ccc(-c4ccccn4)cc3)nc(SC3CCCC3O)nc12
Standard InChI: InChI=1S/C25H28N6OS/c1-15(2)21-22-23(31-30-21)24(29-25(28-22)33-20-8-5-7-19(20)32)27-14-16-9-11-17(12-10-16)18-6-3-4-13-26-18/h3-4,6,9-13,15,19-20,32H,5,7-8,14H2,1-2H3,(H,30,31)(H,27,28,29)
Standard InChI Key: SEKANRVTPMSOAV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
3.2251 -13.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0483 -13.8241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4591 -13.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0479 -12.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2214 -12.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8144 -13.1147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2803 -13.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6922 -13.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5164 -13.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9299 -13.1123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5132 -12.3954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6902 -12.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7550 -13.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1682 -13.8255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9933 -13.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4021 -14.5389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2264 -14.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6390 -13.8229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3983 -13.1105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2168 -13.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4685 -12.3305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8056 -11.8503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1443 -12.3325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2527 -12.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8667 -12.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4231 -11.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6393 -15.2526 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.2273 -15.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4092 -16.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2382 -16.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9530 -17.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5657 -16.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8551 -15.4471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
10 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 20 1 0
19 15 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
21 24 1 0
24 25 1 0
24 26 1 0
17 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
29 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.61Molecular Weight (Monoisotopic): 460.2045AlogP: 5.16#Rotatable Bonds: 7Polar Surface Area: 99.61Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.53CX Basic pKa: 4.42CX LogP: 5.04CX LogD: 5.04Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -0.90
References 1. Jorda R, Havlíček L, Šturc A, Tušková D, Daumová L, Alam M, Škerlová J, Nekardová M, Peřina M, Pospíšil T, Široká J, Urbánek L, Pachl P, Řezáčová P, Strnad M, Klener P, Kryštof V.. (2019) 3,5,7-Substituted Pyrazolo[4,3- d]pyrimidine Inhibitors of Cyclin-Dependent Kinases and Their Evaluation in Lymphoma Models., 62 (9): [PMID:30943029 ] [10.1021/acs.jmedchem.9b00189 ]