The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Alloxy-(R)-4-[((1S,2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl)hydroxymethyl]quinoline ID: ALA4535756
PubChem CID: 155547813
Max Phase: Preclinical
Molecular Formula: C22H28N2O2
Molecular Weight: 352.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CC[N@@]3C[C@@H]4CC)c2c1
Standard InChI: InChI=1S/C22H28N2O2/c1-3-11-26-17-5-6-20-19(13-17)18(7-9-23-20)22(25)21-12-16-8-10-24(21)14-15(16)4-2/h3,5-7,9,13,15-16,21-22,25H,1,4,8,10-12,14H2,2H3/t15-,16-,21-,22+/m0/s1
Standard InChI Key: FCVOIPMRSLIKIN-WWLNLUSPSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
18.7717 -10.7065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9092 -10.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2043 -12.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1959 -11.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4911 -12.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9092 -10.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0412 -9.7155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7343 -9.9560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8836 -9.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4559 -11.1295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4952 -13.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2084 -13.8330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7696 -12.1911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8587 -8.2683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3936 -10.3748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7696 -13.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4827 -10.9429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0646 -12.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9216 -13.4184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0564 -13.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9216 -12.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3431 -12.1911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.1166 -11.7307 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.0087 -9.5372 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.5571 -7.8366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6383 -12.6121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9212 -12.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2164 -12.6335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 4 1 0
4 2 1 0
5 3 1 0
6 2 1 0
8 15 1 0
9 7 1 0
10 1 1 0
11 5 1 0
12 19 2 0
13 5 2 0
9 14 1 1
15 10 1 0
16 11 2 0
4 17 1 1
18 13 1 0
19 21 1 0
20 18 2 0
21 3 2 0
22 18 1 0
2 23 1 1
8 24 1 6
9 8 1 0
8 6 1 0
12 11 1 0
16 20 1 0
14 25 1 0
22 26 1 0
26 27 1 0
27 28 2 0
1 7 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 352.48Molecular Weight (Monoisotopic): 352.2151AlogP: 3.95#Rotatable Bonds: 6Polar Surface Area: 45.59Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.89CX Basic pKa: 9.17CX LogP: 3.55CX LogD: 1.78Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.80Np Likeness Score: 0.50
References 1. Wang X, Zeng Y, Sheng L, Larson P, Liu X, Zou X, Wang S, Guo K, Ma C, Zhang G, Cui H, Ferguson DM, Li Y, Zhang J, Aldrich CC.. (2019) A Cinchona Alkaloid Antibiotic That Appears To Target ATP Synthase in Streptococcus pneumoniae., 62 (5): [PMID:30779564 ] [10.1021/acs.jmedchem.8b01353 ]