The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6,7-Dimethoxy-4-{1-[4-(trifluoromethoxy)benzoyl]piperidin-4-yl}quinazoline ID: ALA4535758
PubChem CID: 137333966
Max Phase: Preclinical
Molecular Formula: C23H22F3N3O4
Molecular Weight: 461.44
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2ncnc(C3CCN(C(=O)c4ccc(OC(F)(F)F)cc4)CC3)c2cc1OC
Standard InChI: InChI=1S/C23H22F3N3O4/c1-31-19-11-17-18(12-20(19)32-2)27-13-28-21(17)14-7-9-29(10-8-14)22(30)15-3-5-16(6-4-15)33-23(24,25)26/h3-6,11-14H,7-10H2,1-2H3
Standard InChI Key: SRRBAUZQZOASOY-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
6.4990 -3.3884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4978 -4.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2059 -4.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9155 -4.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9127 -3.3848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2041 -2.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7898 -4.6160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0824 -4.2068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7891 -5.4332 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0795 -5.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0769 -6.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7824 -7.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4923 -6.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4965 -5.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6189 -2.9736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6158 -2.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3219 -1.7451 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.9065 -1.7504 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.6094 -1.3372 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.7787 -7.8802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7700 -9.5116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4819 -9.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4825 -8.2868 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0636 -9.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0697 -8.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3677 -7.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6591 -8.2755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6570 -9.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3596 -9.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9483 -9.5010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2415 -9.0908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9532 -7.8637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2437 -8.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
5 15 1 0
15 16 1 0
16 17 1 0
16 18 1 0
16 19 1 0
12 20 1 0
20 25 2 0
24 21 2 0
21 22 1 0
22 23 2 0
23 20 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
28 30 1 0
30 31 1 0
27 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.44Molecular Weight (Monoisotopic): 461.1562AlogP: 4.57#Rotatable Bonds: 5Polar Surface Area: 73.78Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.56CX LogP: 4.24CX LogD: 4.24Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.55Np Likeness Score: -1.02
References 1. Nguyen D, Lemos C, Wortmann L, Eis K, Holton SJ, Boemer U, Moosmayer D, Eberspaecher U, Weiske J, Lechner C, Prechtl S, Suelzle D, Siegel F, Prinz F, Lesche R, Nicke B, Nowak-Reppel K, Himmel H, Mumberg D, von Nussbaum F, Nising CF, Bauser M, Haegebarth A.. (2019) Discovery and Characterization of the Potent and Highly Selective (Piperidin-4-yl)pyrido[3,2- d]pyrimidine Based in Vitro Probe BAY-885 for the Kinase ERK5., 62 (2): [PMID:30563338 ] [10.1021/acs.jmedchem.8b01606 ]